oxen-core/src/cryptonote_core/service_node_list.cpp

2589 lines
104 KiB
C++
Raw Normal View History

2018-06-29 06:47:00 +02:00
// Copyright (c) 2018, The Loki Project
//
// All rights reserved.
//
// Redistribution and use in source and binary forms, with or without modification, are
// permitted provided that the following conditions are met:
//
// 1. Redistributions of source code must retain the above copyright notice, this list of
// conditions and the following disclaimer.
//
// 2. Redistributions in binary form must reproduce the above copyright notice, this list
// of conditions and the following disclaimer in the documentation and/or other
// materials provided with the distribution.
//
// 3. Neither the name of the copyright holder nor the names of its contributors may be
// used to endorse or promote products derived from this software without specific
// prior written permission.
//
// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
// EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
// MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL
// THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO,
// PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
// INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT,
// STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF
// THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
#include <functional>
Service Node Deregister Part 5 (#89) * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * core, service_node_list: separated address from service node pubkey * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * Store service node lists for the duration of deregister lifetimes * Quorum min/max bug, sort node list, fix node to test list * Change quorum to store acc pub address, fix oob bug * Code review for expiring votes, acc keys to pub_key, improve err msgs * Add early out for is_deregistration_tx and protect against quorum changes * Remove debug code, fix segfault * Remove irrelevant check for tx v3 in blockchain, fix >= height for pruning quorum states Incorrect assumption that a transaction can be kept in the chain if it could eventually become invalid, because if it were the chain would be split and eventually these transaction would be dropped. But also that we should not override the pre-existing logic which handles this case anyway.
2018-07-18 04:42:47 +02:00
#include <random>
#include <algorithm>
#include <chrono>
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
#include <boost/endian/conversion.hpp>
2018-06-29 06:47:00 +02:00
#include "ringct/rctSigs.h"
#include "wallet/wallet2.h"
#include "cryptonote_tx_utils.h"
Service Node Deregister Part 5 (#89) * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * core, service_node_list: separated address from service node pubkey * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * Store service node lists for the duration of deregister lifetimes * Quorum min/max bug, sort node list, fix node to test list * Change quorum to store acc pub address, fix oob bug * Code review for expiring votes, acc keys to pub_key, improve err msgs * Add early out for is_deregistration_tx and protect against quorum changes * Remove debug code, fix segfault * Remove irrelevant check for tx v3 in blockchain, fix >= height for pruning quorum states Incorrect assumption that a transaction can be kept in the chain if it could eventually become invalid, because if it were the chain would be split and eventually these transaction would be dropped. But also that we should not override the pre-existing logic which handles this case anyway.
2018-07-18 04:42:47 +02:00
#include "cryptonote_basic/tx_extra.h"
#include "int-util.h"
#include "common/scoped_message_writer.h"
#include "common/i18n.h"
#include "common/util.h"
#include "blockchain.h"
#include "service_node_quorum_cop.h"
2018-06-29 06:47:00 +02:00
#include "service_node_list.h"
#include "service_node_rules.h"
#include "service_node_swarm.h"
#include "version.h"
2018-06-29 06:47:00 +02:00
#undef LOKI_DEFAULT_LOG_CATEGORY
#define LOKI_DEFAULT_LOG_CATEGORY "service_nodes"
namespace service_nodes
{
size_t constexpr STORE_LONG_TERM_STATE_INTERVAL = 10000;
static uint64_t short_term_state_cull_height(uint8_t hf_version, cryptonote::BlockchainDB const *db, uint64_t block_height)
{
size_t constexpr DEFAULT_SHORT_TERM_STATE_HISTORY = 6 * STATE_CHANGE_TX_LIFETIME_IN_BLOCKS;
uint64_t result =
(block_height < DEFAULT_SHORT_TERM_STATE_HISTORY) ? 0 : block_height - DEFAULT_SHORT_TERM_STATE_HISTORY;
if (hf_version >= cryptonote::network_version_13_enforce_checkpoints)
{
uint64_t latest_height = db->height() - 1;
cryptonote::checkpoint_t checkpoint;
if (db->get_immutable_checkpoint(&checkpoint, latest_height))
result = std::min(result, checkpoint.height - 1);
}
return result;
}
static int get_min_service_node_info_version_for_hf(uint8_t hf_version)
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
return service_node_info::version_1_add_registration_hf_version;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
service_node_list::service_node_list(cryptonote::Blockchain &blockchain)
: m_blockchain(blockchain)
, m_db(nullptr)
, m_service_node_pubkey(nullptr)
, m_store_quorum_history(0)
, m_state_added_to_archive(false)
{
}
void service_node_list::rescan_starting_from_curr_state(bool store_to_disk)
2018-06-29 06:47:00 +02:00
{
if (m_blockchain.get_current_hard_fork_version() < cryptonote::network_version_9_service_nodes)
return;
auto scan_start = std::chrono::high_resolution_clock::now();
uint64_t chain_height = m_blockchain.get_current_blockchain_height();
uint64_t current_height = chain_height - 1;
if (m_state.height == current_height)
return;
MGINFO("Recalculating service nodes list, scanning blockchain from height: " << m_state.height << " to: " << current_height);
std::vector<std::pair<cryptonote::blobdata, cryptonote::block>> blocks;
std::vector<cryptonote::transaction> txs;
std::vector<crypto::hash> missed_txs;
auto work_start = std::chrono::high_resolution_clock::now();
for (uint64_t i = 0; m_state.height < current_height; i++)
2018-06-29 06:47:00 +02:00
{
if (i > 0 && i % 10 == 0)
{
if (store_to_disk) store();
auto work_end = std::chrono::high_resolution_clock::now();
auto duration = std::chrono::duration_cast<std::chrono::milliseconds>(work_end - work_start);
MGINFO("... scanning height " << m_state.height << " (" << duration.count() / 1000.f << "s)");
work_start = std::chrono::high_resolution_clock::now();
}
blocks.clear();
if (!m_blockchain.get_blocks(m_state.height + 1, 1000, blocks))
2018-06-29 06:47:00 +02:00
{
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
MERROR("Unable to initialize service nodes list");
2018-06-29 06:47:00 +02:00
return;
}
if (blocks.empty())
break;
Service Node Deregister Part 5 (#89) * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * core, service_node_list: separated address from service node pubkey * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * Store service node lists for the duration of deregister lifetimes * Quorum min/max bug, sort node list, fix node to test list * Change quorum to store acc pub address, fix oob bug * Code review for expiring votes, acc keys to pub_key, improve err msgs * Add early out for is_deregistration_tx and protect against quorum changes * Remove debug code, fix segfault * Remove irrelevant check for tx v3 in blockchain, fix >= height for pruning quorum states Incorrect assumption that a transaction can be kept in the chain if it could eventually become invalid, because if it were the chain would be split and eventually these transaction would be dropped. But also that we should not override the pre-existing logic which handles this case anyway.
2018-07-18 04:42:47 +02:00
2018-06-29 06:47:00 +02:00
for (const auto& block_pair : blocks)
{
txs.clear();
missed_txs.clear();
2018-06-29 06:47:00 +02:00
const cryptonote::block& block = block_pair.second;
if (!m_blockchain.get_transactions(block.tx_hashes, txs, missed_txs))
{
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
MERROR("Unable to get transactions for block " << block.hash);
2018-06-29 06:47:00 +02:00
return;
}
Service Node Deregister Part 5 (#89) * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * core, service_node_list: separated address from service node pubkey * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * Store service node lists for the duration of deregister lifetimes * Quorum min/max bug, sort node list, fix node to test list * Change quorum to store acc pub address, fix oob bug * Code review for expiring votes, acc keys to pub_key, improve err msgs * Add early out for is_deregistration_tx and protect against quorum changes * Remove debug code, fix segfault * Remove irrelevant check for tx v3 in blockchain, fix >= height for pruning quorum states Incorrect assumption that a transaction can be kept in the chain if it could eventually become invalid, because if it were the chain would be split and eventually these transaction would be dropped. But also that we should not override the pre-existing logic which handles this case anyway.
2018-07-18 04:42:47 +02:00
process_block(block, txs);
2018-06-29 06:47:00 +02:00
}
}
auto scan_end = std::chrono::high_resolution_clock::now();
auto duration = std::chrono::duration_cast<std::chrono::milliseconds>(scan_end - scan_start);
MGINFO("Done recalculating service nodes list (" << duration.count() / 1000.f << "s)");
if (store_to_disk) store();
2018-06-29 06:47:00 +02:00
}
// TODO(loki): Temporary HF13 code, remove when we hit HF13 because we delete all HF12 checkpoints and don't need conditionals for HF12/HF13 checkpointing code
static uint64_t hf13_height;
void service_node_list::init()
{
// TODO(loki): Temporary HF13 code, remove when we hit HF13 because we delete all HF12 checkpoints and don't need conditionals for HF12/HF13 checkpointing code
hf13_height = m_blockchain.get_earliest_ideal_height_for_version(cryptonote::network_version_13_enforce_checkpoints);
std::lock_guard<boost::recursive_mutex> lock(m_sn_mutex);
if (m_blockchain.get_current_hard_fork_version() < 9)
{
reset(true);
return;
}
uint64_t current_height = m_blockchain.get_current_blockchain_height();
bool loaded = load(current_height);
if (loaded && m_old_quorum_states.size() < std::min(m_store_quorum_history, uint64_t{10})) {
LOG_PRINT_L0("Full history storage requested, but " << m_old_quorum_states.size() << " old quorum states found");
loaded = false; // Either we don't have stored history or the history is very short, so recalculation is necessary or cheap.
}
bool store_to_disk = false;
if (!loaded || m_state.height > current_height)
{
reset(true);
store_to_disk = true;
}
rescan_starting_from_curr_state(store_to_disk);
}
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
template <typename UnaryPredicate>
static std::vector<service_nodes::pubkey_and_sninfo> sort_and_filter(const service_nodes_infos_t &sns_infos, UnaryPredicate p, bool reserve = true) {
std::vector<pubkey_and_sninfo> result;
if (reserve) result.reserve(sns_infos.size());
for (const pubkey_and_sninfo &key_info : sns_infos)
Use shared_ptr storage for service_node_info This converts the stored service_node_info value into a `shared_ptr<const service_node_info>` rather than a plain `service_node_info`. This yields a huge performance benefit by significantly eliminating the vast majority of service_node_info construction, destruction, and copying. Most of the time when we copy a service_node_info nothing in it has changed, which means we're storing exactly the same thing; this means an extra construction for every SN info on every block *and* an extra destruction when we cull old stored history. By using a shared_ptr, the vast majority of those constructions and destructions are eliminated. The immediately previous commit (upon which this one builds) already reduced a full rescan from 180s to 171s; this commit further reduces that time to 104s, or about 42% reduced from the rescan time required before this pair of commits. (All timings are from the dev.lokinet.org box, tested over multiple runs with the entire lmdb cached in memory). With the shared_ptr approach, we only make a copy when a change is actually needed: because of infrequent (at the per-SN level) events like a state_change, received reward, contribution, etc. The contained reference is deliberately `const` so that values are not changeable; there's a new function that does an explicit copying duplication, returning the new non-const and storing the const ref in the shared pointer. Related to this is a small change (and fix) to how proof info and public_ip/storage_port are stored: rather than store the values in the service_node_info struct itself, they now gets stored in a shared_ptr inside the service_node_info that intentionally gets shared among all copies of the service_node_info (that is, a SN info copy deliberately copies the pointer rather than the values). This also moves the ip/port values into the proof struct, since that seemed much easier than maintaining a separate shared_ptr for each value. Previously, because these were stored as values in the service_node_info they would actually get rolled back in the event of a reorg, but that seems highly undesirable: you would end up rolling back to the old values of the uptime proof and ip address (for example), but that should not happen: those values are not dependent on the blockchain and so should not be affected by a reorg/rollback. With this change they aren't since there is only one actual proof stored. Note that the shared storage here only applies to in-memory states; states loaded from the db will still be duplicated.
2019-08-11 18:19:24 +02:00
if (p(*key_info.second))
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
result.push_back(key_info);
Service Node Deregister Part 5 (#89) * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * core, service_node_list: separated address from service node pubkey * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * Store service node lists for the duration of deregister lifetimes * Quorum min/max bug, sort node list, fix node to test list * Change quorum to store acc pub address, fix oob bug * Code review for expiring votes, acc keys to pub_key, improve err msgs * Add early out for is_deregistration_tx and protect against quorum changes * Remove debug code, fix segfault * Remove irrelevant check for tx v3 in blockchain, fix >= height for pruning quorum states Incorrect assumption that a transaction can be kept in the chain if it could eventually become invalid, because if it were the chain would be split and eventually these transaction would be dropped. But also that we should not override the pre-existing logic which handles this case anyway.
2018-07-18 04:42:47 +02:00
std::sort(result.begin(), result.end(),
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
[](const pubkey_and_sninfo &a, const pubkey_and_sninfo &b) {
Service Node Deregister Part 5 (#89) * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * core, service_node_list: separated address from service node pubkey * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * Store service node lists for the duration of deregister lifetimes * Quorum min/max bug, sort node list, fix node to test list * Change quorum to store acc pub address, fix oob bug * Code review for expiring votes, acc keys to pub_key, improve err msgs * Add early out for is_deregistration_tx and protect against quorum changes * Remove debug code, fix segfault * Remove irrelevant check for tx v3 in blockchain, fix >= height for pruning quorum states Incorrect assumption that a transaction can be kept in the chain if it could eventually become invalid, because if it were the chain would be split and eventually these transaction would be dropped. But also that we should not override the pre-existing logic which handles this case anyway.
2018-07-18 04:42:47 +02:00
return memcmp(reinterpret_cast<const void*>(&a), reinterpret_cast<const void*>(&b), sizeof(a)) < 0;
});
return result;
}
std::vector<pubkey_and_sninfo> service_node_list::state_t::active_service_nodes_infos() const {
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
return sort_and_filter(service_nodes_infos, [](const service_node_info &info) { return info.is_active(); });
}
std::vector<pubkey_and_sninfo> service_node_list::state_t::decommissioned_service_nodes_infos() const {
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
return sort_and_filter(service_nodes_infos, [](const service_node_info &info) { return info.is_decommissioned() && info.is_fully_funded(); }, /*reserve=*/ false);
}
std::shared_ptr<const testing_quorum> service_node_list::get_testing_quorum(quorum_type type, uint64_t height, bool include_old, std::vector<std::shared_ptr<const testing_quorum>> *alt_quorums) const
Service Node Deregister Part 5 (#89) * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * core, service_node_list: separated address from service node pubkey * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * Store service node lists for the duration of deregister lifetimes * Quorum min/max bug, sort node list, fix node to test list * Change quorum to store acc pub address, fix oob bug * Code review for expiring votes, acc keys to pub_key, improve err msgs * Add early out for is_deregistration_tx and protect against quorum changes * Remove debug code, fix segfault * Remove irrelevant check for tx v3 in blockchain, fix >= height for pruning quorum states Incorrect assumption that a transaction can be kept in the chain if it could eventually become invalid, because if it were the chain would be split and eventually these transaction would be dropped. But also that we should not override the pre-existing logic which handles this case anyway.
2018-07-18 04:42:47 +02:00
{
height = offset_testing_quorum_height(type, height);
std::lock_guard<boost::recursive_mutex> lock(m_sn_mutex);
quorum_manager const *quorums = nullptr;
if (height == m_state.height)
quorums = &m_state.quorums;
else // NOTE: Search m_state_history && m_state_archive
{
auto it = m_state_history.find(height);
if (it != m_state_history.end())
quorums = &it->quorums;
if (!quorums)
{
auto it = m_state_archive.find(height);
if (it != m_state_archive.end()) quorums = &it->quorums;
}
}
if (!quorums && include_old) // NOTE: Search m_old_quorum_states
{
auto it =
std::lower_bound(m_old_quorum_states.begin(),
m_old_quorum_states.end(),
height,
[](quorums_by_height const &entry, uint64_t height) { return entry.height < height; });
if (it != m_old_quorum_states.end() && it->height == height)
quorums = &it->quorums;
}
if (!quorums)
return nullptr;
if (alt_quorums)
{
for (std::pair<crypto::hash, state_t> const &hash_to_state : m_alt_state)
{
state_t const &alt_state = hash_to_state.second;
if (alt_state.height == height)
{
std::shared_ptr<const testing_quorum> alt_result = alt_state.quorums.get(type);
if (alt_result) alt_quorums->push_back(alt_result);
}
}
}
std::shared_ptr<const testing_quorum> result = quorums->get(type);
return result;
2018-06-29 06:47:00 +02:00
}
static bool get_pubkey_from_quorum(testing_quorum const &quorum, quorum_group group, size_t quorum_index, crypto::public_key &key)
{
std::vector<crypto::public_key> const *array = nullptr;
if (group == quorum_group::validator) array = &quorum.validators;
else if (group == quorum_group::worker) array = &quorum.workers;
else
{
MERROR("Invalid quorum group specified");
return false;
}
if (quorum_index >= array->size())
{
MERROR("Quorum indexing out of bounds: " << quorum_index << ", quorum_size: " << array->size());
return false;
}
key = (*array)[quorum_index];
return true;
}
bool service_node_list::get_quorum_pubkey(quorum_type type, quorum_group group, uint64_t height, size_t quorum_index, crypto::public_key &key) const
{
std::shared_ptr<const testing_quorum> quorum = get_testing_quorum(type, height);
if (!quorum)
{
LOG_PRINT_L1("Quorum for height: " << height << ", was not stored by the daemon");
return false;
}
bool result = get_pubkey_from_quorum(*quorum, group, quorum_index, key);
return result;
}
std::vector<service_node_pubkey_info> service_node_list::get_service_node_list_state(const std::vector<crypto::public_key> &service_node_pubkeys) const
{
std::lock_guard<boost::recursive_mutex> lock(m_sn_mutex);
std::vector<service_node_pubkey_info> result;
if (service_node_pubkeys.empty())
{
result.reserve(m_state.service_nodes_infos.size());
for (const auto &info : m_state.service_nodes_infos)
result.emplace_back(info);
}
else
{
result.reserve(service_node_pubkeys.size());
for (const auto &it : service_node_pubkeys)
{
auto find_it = m_state.service_nodes_infos.find(it);
if (find_it != m_state.service_nodes_infos.end())
result.emplace_back(*find_it);
}
}
return result;
}
void service_node_list::set_db_pointer(cryptonote::BlockchainDB* db)
{
std::lock_guard<boost::recursive_mutex> lock(m_sn_mutex);
m_db = db;
}
void service_node_list::set_my_service_node_keys(crypto::public_key const *pub_key)
{
std::lock_guard<boost::recursive_mutex> lock(m_sn_mutex);
m_service_node_pubkey = pub_key;
}
void service_node_list::set_quorum_history_storage(uint64_t hist_size) {
if (hist_size == 1)
hist_size = std::numeric_limits<uint64_t>::max();
m_store_quorum_history = hist_size;
}
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
bool service_node_list::is_service_node(const crypto::public_key& pubkey, bool require_active) const
{
std::lock_guard<boost::recursive_mutex> lock(m_sn_mutex);
auto it = m_state.service_nodes_infos.find(pubkey);
Use shared_ptr storage for service_node_info This converts the stored service_node_info value into a `shared_ptr<const service_node_info>` rather than a plain `service_node_info`. This yields a huge performance benefit by significantly eliminating the vast majority of service_node_info construction, destruction, and copying. Most of the time when we copy a service_node_info nothing in it has changed, which means we're storing exactly the same thing; this means an extra construction for every SN info on every block *and* an extra destruction when we cull old stored history. By using a shared_ptr, the vast majority of those constructions and destructions are eliminated. The immediately previous commit (upon which this one builds) already reduced a full rescan from 180s to 171s; this commit further reduces that time to 104s, or about 42% reduced from the rescan time required before this pair of commits. (All timings are from the dev.lokinet.org box, tested over multiple runs with the entire lmdb cached in memory). With the shared_ptr approach, we only make a copy when a change is actually needed: because of infrequent (at the per-SN level) events like a state_change, received reward, contribution, etc. The contained reference is deliberately `const` so that values are not changeable; there's a new function that does an explicit copying duplication, returning the new non-const and storing the const ref in the shared pointer. Related to this is a small change (and fix) to how proof info and public_ip/storage_port are stored: rather than store the values in the service_node_info struct itself, they now gets stored in a shared_ptr inside the service_node_info that intentionally gets shared among all copies of the service_node_info (that is, a SN info copy deliberately copies the pointer rather than the values). This also moves the ip/port values into the proof struct, since that seemed much easier than maintaining a separate shared_ptr for each value. Previously, because these were stored as values in the service_node_info they would actually get rolled back in the event of a reorg, but that seems highly undesirable: you would end up rolling back to the old values of the uptime proof and ip address (for example), but that should not happen: those values are not dependent on the blockchain and so should not be affected by a reorg/rollback. With this change they aren't since there is only one actual proof stored. Note that the shared storage here only applies to in-memory states; states loaded from the db will still be duplicated.
2019-08-11 18:19:24 +02:00
return it != m_state.service_nodes_infos.end() && (!require_active || it->second->is_active());
}
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
bool service_node_list::is_key_image_locked(crypto::key_image const &check_image, uint64_t *unlock_height, service_node_info::contribution_t *the_locked_contribution) const
2018-06-29 06:47:00 +02:00
{
for (const auto& pubkey_info : m_state.service_nodes_infos)
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
Use shared_ptr storage for service_node_info This converts the stored service_node_info value into a `shared_ptr<const service_node_info>` rather than a plain `service_node_info`. This yields a huge performance benefit by significantly eliminating the vast majority of service_node_info construction, destruction, and copying. Most of the time when we copy a service_node_info nothing in it has changed, which means we're storing exactly the same thing; this means an extra construction for every SN info on every block *and* an extra destruction when we cull old stored history. By using a shared_ptr, the vast majority of those constructions and destructions are eliminated. The immediately previous commit (upon which this one builds) already reduced a full rescan from 180s to 171s; this commit further reduces that time to 104s, or about 42% reduced from the rescan time required before this pair of commits. (All timings are from the dev.lokinet.org box, tested over multiple runs with the entire lmdb cached in memory). With the shared_ptr approach, we only make a copy when a change is actually needed: because of infrequent (at the per-SN level) events like a state_change, received reward, contribution, etc. The contained reference is deliberately `const` so that values are not changeable; there's a new function that does an explicit copying duplication, returning the new non-const and storing the const ref in the shared pointer. Related to this is a small change (and fix) to how proof info and public_ip/storage_port are stored: rather than store the values in the service_node_info struct itself, they now gets stored in a shared_ptr inside the service_node_info that intentionally gets shared among all copies of the service_node_info (that is, a SN info copy deliberately copies the pointer rather than the values). This also moves the ip/port values into the proof struct, since that seemed much easier than maintaining a separate shared_ptr for each value. Previously, because these were stored as values in the service_node_info they would actually get rolled back in the event of a reorg, but that seems highly undesirable: you would end up rolling back to the old values of the uptime proof and ip address (for example), but that should not happen: those values are not dependent on the blockchain and so should not be affected by a reorg/rollback. With this change they aren't since there is only one actual proof stored. Note that the shared storage here only applies to in-memory states; states loaded from the db will still be duplicated.
2019-08-11 18:19:24 +02:00
const service_node_info &info = *pubkey_info.second;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
for (const service_node_info::contributor_t &contributor : info.contributors)
{
for (const service_node_info::contribution_t &contribution : contributor.locked_contributions)
{
if (check_image == contribution.key_image)
{
if (the_locked_contribution) *the_locked_contribution = contribution;
if (unlock_height) *unlock_height = info.requested_unlock_height;
return true;
}
}
}
}
return false;
2018-06-29 06:47:00 +02:00
}
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
bool reg_tx_extract_fields(const cryptonote::transaction& tx, std::vector<cryptonote::account_public_address>& addresses, uint64_t& portions_for_operator, std::vector<uint64_t>& portions, uint64_t& expiration_timestamp, crypto::public_key& service_node_key, crypto::signature& signature)
2018-06-29 06:47:00 +02:00
{
cryptonote::tx_extra_service_node_register registration;
if (!get_service_node_register_from_tx_extra(tx.extra, registration))
return false;
if (!cryptonote::get_service_node_pubkey_from_tx_extra(tx.extra, service_node_key))
return false;
addresses.clear();
addresses.reserve(registration.m_public_spend_keys.size());
for (size_t i = 0; i < registration.m_public_spend_keys.size(); i++) {
addresses.emplace_back();
addresses.back().m_spend_public_key = registration.m_public_spend_keys[i];
addresses.back().m_view_public_key = registration.m_public_view_keys[i];
}
portions_for_operator = registration.m_portions_for_operator;
portions = registration.m_portions;
expiration_timestamp = registration.m_expiration_timestamp;
signature = registration.m_service_node_signature;
return true;
2018-06-29 06:47:00 +02:00
}
uint64_t offset_testing_quorum_height(quorum_type type, uint64_t height)
{
uint64_t result = height;
if (type == quorum_type::checkpointing)
{
if (result < REORG_SAFETY_BUFFER_BLOCKS_POST_HF12)
return 0;
result -= REORG_SAFETY_BUFFER_BLOCKS_POST_HF12;
}
return result;
}
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
struct parsed_tx_contribution
{
cryptonote::account_public_address address;
uint64_t transferred;
crypto::secret_key tx_key;
std::vector<service_node_info::contribution_t> locked_contributions;
};
static uint64_t get_reg_tx_staking_output_contribution(const cryptonote::transaction& tx, int i, crypto::key_derivation const &derivation, hw::device& hwdev)
2018-06-29 06:47:00 +02:00
{
if (tx.vout[i].target.type() != typeid(cryptonote::txout_to_key))
{
return 0;
2018-06-29 06:47:00 +02:00
}
rct::key mask;
uint64_t money_transferred = 0;
crypto::secret_key scalar1;
hwdev.derivation_to_scalar(derivation, i, scalar1);
try
{
switch (tx.rct_signatures.type)
{
case rct::RCTTypeSimple:
case rct::RCTTypeBulletproof:
2019-01-30 04:44:00 +01:00
case rct::RCTTypeBulletproof2:
2018-06-29 06:47:00 +02:00
money_transferred = rct::decodeRctSimple(tx.rct_signatures, rct::sk2rct(scalar1), i, mask, hwdev);
break;
case rct::RCTTypeFull:
money_transferred = rct::decodeRct(tx.rct_signatures, rct::sk2rct(scalar1), i, mask, hwdev);
break;
default:
LOG_PRINT_L0("Unsupported rct type: " << tx.rct_signatures.type);
return 0;
2018-06-29 06:47:00 +02:00
}
}
catch (const std::exception &e)
{
LOG_PRINT_L0("Failed to decode input " << i);
return 0;
2018-06-29 06:47:00 +02:00
}
return money_transferred;
2018-06-29 06:47:00 +02:00
}
Use shared_ptr storage for service_node_info This converts the stored service_node_info value into a `shared_ptr<const service_node_info>` rather than a plain `service_node_info`. This yields a huge performance benefit by significantly eliminating the vast majority of service_node_info construction, destruction, and copying. Most of the time when we copy a service_node_info nothing in it has changed, which means we're storing exactly the same thing; this means an extra construction for every SN info on every block *and* an extra destruction when we cull old stored history. By using a shared_ptr, the vast majority of those constructions and destructions are eliminated. The immediately previous commit (upon which this one builds) already reduced a full rescan from 180s to 171s; this commit further reduces that time to 104s, or about 42% reduced from the rescan time required before this pair of commits. (All timings are from the dev.lokinet.org box, tested over multiple runs with the entire lmdb cached in memory). With the shared_ptr approach, we only make a copy when a change is actually needed: because of infrequent (at the per-SN level) events like a state_change, received reward, contribution, etc. The contained reference is deliberately `const` so that values are not changeable; there's a new function that does an explicit copying duplication, returning the new non-const and storing the const ref in the shared pointer. Related to this is a small change (and fix) to how proof info and public_ip/storage_port are stored: rather than store the values in the service_node_info struct itself, they now gets stored in a shared_ptr inside the service_node_info that intentionally gets shared among all copies of the service_node_info (that is, a SN info copy deliberately copies the pointer rather than the values). This also moves the ip/port values into the proof struct, since that seemed much easier than maintaining a separate shared_ptr for each value. Previously, because these were stored as values in the service_node_info they would actually get rolled back in the event of a reorg, but that seems highly undesirable: you would end up rolling back to the old values of the uptime proof and ip address (for example), but that should not happen: those values are not dependent on the blockchain and so should not be affected by a reorg/rollback. With this change they aren't since there is only one actual proof stored. Note that the shared storage here only applies to in-memory states; states loaded from the db will still be duplicated.
2019-08-11 18:19:24 +02:00
/// Makes a copy of the given service_node_info and replaces the shared_ptr with a pointer to the copy.
/// Returns the non-const service_node_info (which is now held by the passed-in shared_ptr lvalue ref).
static service_node_info &duplicate_info(std::shared_ptr<const service_node_info> &info_ptr) {
auto new_ptr = std::make_shared<service_node_info>(*info_ptr);
info_ptr = new_ptr;
return *new_ptr;
}
bool service_node_list::state_t::process_state_change_tx(std::set<state_t> const &state_history,
std::unordered_map<crypto::hash, state_t> const &alt_states,
cryptonote::network_type nettype,
const cryptonote::block &block,
const cryptonote::transaction &tx,
crypto::public_key const *my_pubkey)
Service Node Deregister Part 5 (#89) * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * core, service_node_list: separated address from service node pubkey * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * Store service node lists for the duration of deregister lifetimes * Quorum min/max bug, sort node list, fix node to test list * Change quorum to store acc pub address, fix oob bug * Code review for expiring votes, acc keys to pub_key, improve err msgs * Add early out for is_deregistration_tx and protect against quorum changes * Remove debug code, fix segfault * Remove irrelevant check for tx v3 in blockchain, fix >= height for pruning quorum states Incorrect assumption that a transaction can be kept in the chain if it could eventually become invalid, because if it were the chain would be split and eventually these transaction would be dropped. But also that we should not override the pre-existing logic which handles this case anyway.
2018-07-18 04:42:47 +02:00
{
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
if (tx.type != cryptonote::txtype::state_change)
return false;
Service Node Deregister Part 5 (#89) * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * core, service_node_list: separated address from service node pubkey * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * Store service node lists for the duration of deregister lifetimes * Quorum min/max bug, sort node list, fix node to test list * Change quorum to store acc pub address, fix oob bug * Code review for expiring votes, acc keys to pub_key, improve err msgs * Add early out for is_deregistration_tx and protect against quorum changes * Remove debug code, fix segfault * Remove irrelevant check for tx v3 in blockchain, fix >= height for pruning quorum states Incorrect assumption that a transaction can be kept in the chain if it could eventually become invalid, because if it were the chain would be split and eventually these transaction would be dropped. But also that we should not override the pre-existing logic which handles this case anyway.
2018-07-18 04:42:47 +02:00
uint8_t const hf_version = block.major_version;
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
cryptonote::tx_extra_service_node_state_change state_change;
if (!cryptonote::get_service_node_state_change_from_tx_extra(tx.extra, state_change, hf_version))
Service Node Deregister Part 5 (#89) * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * core, service_node_list: separated address from service node pubkey * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * Store service node lists for the duration of deregister lifetimes * Quorum min/max bug, sort node list, fix node to test list * Change quorum to store acc pub address, fix oob bug * Code review for expiring votes, acc keys to pub_key, improve err msgs * Add early out for is_deregistration_tx and protect against quorum changes * Remove debug code, fix segfault * Remove irrelevant check for tx v3 in blockchain, fix >= height for pruning quorum states Incorrect assumption that a transaction can be kept in the chain if it could eventually become invalid, because if it were the chain would be split and eventually these transaction would be dropped. But also that we should not override the pre-existing logic which handles this case anyway.
2018-07-18 04:42:47 +02:00
{
LOG_PRINT_L1("Transaction: " << cryptonote::get_transaction_hash(tx) << ", did not have valid state change data in tx extra rejecting malformed tx");
return false;
}
auto it = state_history.find(state_change.block_height);
if (it == state_history.end())
{
LOG_PRINT_L1("Transaction: " << cryptonote::get_transaction_hash(tx) << ", references quorum at height: " << cryptonote::get_block_hash(block) << ", that is not stored");
return false;
}
quorum_manager const *quorums = &it->quorums;
cryptonote::tx_verification_context tvc = {};
if (!verify_tx_state_change(
state_change, cryptonote::get_block_height(block), tvc, *quorums->obligations, hf_version))
{
quorums = nullptr;
for (std::pair<crypto::hash, state_t> const &entry : alt_states)
{
state_t const &alt_state = entry.second;
if (alt_state.height != state_change.block_height) continue;
quorums = &alt_state.quorums;
if (!verify_tx_state_change(state_change, cryptonote::get_block_height(block), tvc, *quorums->obligations, hf_version))
{
quorums = nullptr;
continue;
}
}
}
if (!quorums)
{
LOG_PRINT_L1("Could not get a quorum that could completely validate the votes from state change in tx: " << get_transaction_hash(tx) << ", skipping transaction");
return false;
Service Node Deregister Part 5 (#89) * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * core, service_node_list: separated address from service node pubkey * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * Store service node lists for the duration of deregister lifetimes * Quorum min/max bug, sort node list, fix node to test list * Change quorum to store acc pub address, fix oob bug * Code review for expiring votes, acc keys to pub_key, improve err msgs * Add early out for is_deregistration_tx and protect against quorum changes * Remove debug code, fix segfault * Remove irrelevant check for tx v3 in blockchain, fix >= height for pruning quorum states Incorrect assumption that a transaction can be kept in the chain if it could eventually become invalid, because if it were the chain would be split and eventually these transaction would be dropped. But also that we should not override the pre-existing logic which handles this case anyway.
2018-07-18 04:42:47 +02:00
}
crypto::public_key key;
if (!get_pubkey_from_quorum(*quorums->obligations, quorum_group::worker, state_change.service_node_index, key))
{
LOG_PRINT_L1("Retrieving the public key from state change in tx: " << cryptonote::get_transaction_hash(tx) << " failed");
return false;
}
auto iter = service_nodes_infos.find(key);
if (iter == service_nodes_infos.end()) {
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
LOG_PRINT_L2("Received state change tx for non-registered service node " << key << " (perhaps a delayed tx?)");
return false;
}
uint64_t block_height = cryptonote::get_block_height(block);
Use shared_ptr storage for service_node_info This converts the stored service_node_info value into a `shared_ptr<const service_node_info>` rather than a plain `service_node_info`. This yields a huge performance benefit by significantly eliminating the vast majority of service_node_info construction, destruction, and copying. Most of the time when we copy a service_node_info nothing in it has changed, which means we're storing exactly the same thing; this means an extra construction for every SN info on every block *and* an extra destruction when we cull old stored history. By using a shared_ptr, the vast majority of those constructions and destructions are eliminated. The immediately previous commit (upon which this one builds) already reduced a full rescan from 180s to 171s; this commit further reduces that time to 104s, or about 42% reduced from the rescan time required before this pair of commits. (All timings are from the dev.lokinet.org box, tested over multiple runs with the entire lmdb cached in memory). With the shared_ptr approach, we only make a copy when a change is actually needed: because of infrequent (at the per-SN level) events like a state_change, received reward, contribution, etc. The contained reference is deliberately `const` so that values are not changeable; there's a new function that does an explicit copying duplication, returning the new non-const and storing the const ref in the shared pointer. Related to this is a small change (and fix) to how proof info and public_ip/storage_port are stored: rather than store the values in the service_node_info struct itself, they now gets stored in a shared_ptr inside the service_node_info that intentionally gets shared among all copies of the service_node_info (that is, a SN info copy deliberately copies the pointer rather than the values). This also moves the ip/port values into the proof struct, since that seemed much easier than maintaining a separate shared_ptr for each value. Previously, because these were stored as values in the service_node_info they would actually get rolled back in the event of a reorg, but that seems highly undesirable: you would end up rolling back to the old values of the uptime proof and ip address (for example), but that should not happen: those values are not dependent on the blockchain and so should not be affected by a reorg/rollback. With this change they aren't since there is only one actual proof stored. Note that the shared storage here only applies to in-memory states; states loaded from the db will still be duplicated.
2019-08-11 18:19:24 +02:00
auto &info = duplicate_info(iter->second);
bool is_me = my_pubkey && *my_pubkey == key;
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
switch (state_change.state) {
case new_state::deregister:
if (is_me)
MGINFO_RED("Deregistration for service node (yours): " << key);
else
LOG_PRINT_L1("Deregistration for service node: " << key);
if (hf_version >= cryptonote::network_version_11_infinite_staking)
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
for (const auto &contributor : info.contributors)
{
for (const auto &contribution : contributor.locked_contributions)
{
key_image_blacklist.emplace_back(); // NOTE: Use default value for version in key_image_blacklist_entry
key_image_blacklist_entry &entry = key_image_blacklist.back();
entry.key_image = contribution.key_image;
entry.unlock_height = block_height + staking_num_lock_blocks(nettype);
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
}
}
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
service_nodes_infos.erase(iter);
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
return true;
case new_state::decommission:
if (hf_version < cryptonote::network_version_12_checkpointing) {
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
MERROR("Invalid decommission transaction seen before network v12");
return false;
}
if (info.is_decommissioned()) {
LOG_PRINT_L2("Received decommission tx for already-decommissioned service node " << key << "; ignoring");
return false;
}
if (is_me)
MGINFO_RED("Temporary decommission for service node (yours): " << key);
else
LOG_PRINT_L1("Temporary decommission for service node: " << key);
info.active_since_height = -info.active_since_height;
info.last_decommission_height = block_height;
info.decommission_count++;
if (hf_version >= cryptonote::network_version_13_enforce_checkpoints) {
// Assigning invalid swarm id effectively kicks the node off
// its current swarm; it will be assigned a new swarm id when it
// gets recommissioned. Prior to HF13 this step was incorrectly
// skipped.
info.swarm_id = UNASSIGNED_SWARM_ID;
}
Fix 4.0.4 uptime proof transmission after recomm When a node gets recommissioned in 4.0.4 we reset its timestamp to the current time to delay obligations checks for newly recommissioned nodes, but this reset caused problems: - the code runs not only when a fresh block is received, but also when syncing or rescanning, and so time(NULL) gets used to update the node's timestamp even if it is an old record, and since proof info is shared across states, the affects the current state. - as a result of the above, a just-rescanned node that has been decommissioned at some point in the past will think it has just sent a proof, and so won't send any proofs for an hour. - A just-rescanned node won't accept or relay any proofs for any node that was recommissioned in its scan for the first half an hour, but this lack of relaying can cause chaos in getting uptime proofs out across the network, especially while we still have 4.0.3 nodes that need it. To address the first issue, this switches the recommissioning to use the block timestamp rather than the current timestamp. This *will* be slightly delayed in the case of current blocks (since a block timestamp is the time the pool *started* working on the block, which is generally the time the previous block was found on the network), but even with an exceptionally long block delay (e.g. 20 minutes) we are still fending off obligations checks for 1h40m. That would partially fix issues 2 and 3, but we actually don't want a recommissioning to look like a received uptime proof for a couple reasons: - When we haven't actually received an uptime proof it's confusing to report that we have (at the recommission time) and may mask an underlying issue of a node that isn't actually sending proofs for some reason (which might be more common for a node that has just been decommissioned/recommissioned). There's also a related weird state here for nodes that have come on recently: they think the SN is active, but have 0's for IP and storage server port. - 4.0.3 nodes don't get the updated timestamp and so really need the proof to come through even when the 4.0.4 nodes don't think it's important/acceptable. So to also fix these, this commits adds an "effective_timestamp" to the proof info: if it is larger than the actual timestamp field, we use it instead of the actual one for obligations checking. On a recommission, we update only the effective field so that we can delay obligations checking for a couple of hours without delaying actual proofs info going over the network.
2019-08-16 19:31:58 +02:00
info.proof->update_timestamp(0);
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
return true;
case new_state::recommission:
if (hf_version < cryptonote::network_version_12_checkpointing) {
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
MERROR("Invalid recommission transaction seen before network v12");
return false;
}
if (!info.is_decommissioned()) {
LOG_PRINT_L2("Received recommission tx for already-active service node " << key << "; ignoring");
return false;
}
if (is_me)
MGINFO_GREEN("Recommission for service node (yours): " << key);
else
LOG_PRINT_L1("Recommission for service node: " << key);
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
info.active_since_height = block_height;
// Move the SN at the back of the list as if it had just registered (or just won)
info.last_reward_block_height = block_height;
info.last_reward_transaction_index = std::numeric_limits<uint32_t>::max();
// NOTE: Only the quorum deciding on this node agrees that the service
// node has a recent uptime atleast for it to be recommissioned not
// necessarily the entire network. Ensure the entire network agrees
// simultaneously they are online if we are recommissioning by resetting
Fix 4.0.4 uptime proof transmission after recomm When a node gets recommissioned in 4.0.4 we reset its timestamp to the current time to delay obligations checks for newly recommissioned nodes, but this reset caused problems: - the code runs not only when a fresh block is received, but also when syncing or rescanning, and so time(NULL) gets used to update the node's timestamp even if it is an old record, and since proof info is shared across states, the affects the current state. - as a result of the above, a just-rescanned node that has been decommissioned at some point in the past will think it has just sent a proof, and so won't send any proofs for an hour. - A just-rescanned node won't accept or relay any proofs for any node that was recommissioned in its scan for the first half an hour, but this lack of relaying can cause chaos in getting uptime proofs out across the network, especially while we still have 4.0.3 nodes that need it. To address the first issue, this switches the recommissioning to use the block timestamp rather than the current timestamp. This *will* be slightly delayed in the case of current blocks (since a block timestamp is the time the pool *started* working on the block, which is generally the time the previous block was found on the network), but even with an exceptionally long block delay (e.g. 20 minutes) we are still fending off obligations checks for 1h40m. That would partially fix issues 2 and 3, but we actually don't want a recommissioning to look like a received uptime proof for a couple reasons: - When we haven't actually received an uptime proof it's confusing to report that we have (at the recommission time) and may mask an underlying issue of a node that isn't actually sending proofs for some reason (which might be more common for a node that has just been decommissioned/recommissioned). There's also a related weird state here for nodes that have come on recently: they think the SN is active, but have 0's for IP and storage server port. - 4.0.3 nodes don't get the updated timestamp and so really need the proof to come through even when the 4.0.4 nodes don't think it's important/acceptable. So to also fix these, this commits adds an "effective_timestamp" to the proof info: if it is larger than the actual timestamp field, we use it instead of the actual one for obligations checking. On a recommission, we update only the effective field so that we can delay obligations checking for a couple of hours without delaying actual proofs info going over the network.
2019-08-16 19:31:58 +02:00
// the failure conditions. We set only the effective but not *actual*
// timestamp so that we delay obligations checks but don't prevent the
// next actual proof from being sent/relayed.
info.proof->effective_timestamp = block.timestamp;
info.proof->votes.fill({});
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
return true;
case new_state::ip_change_penalty:
if (hf_version < cryptonote::network_version_12_checkpointing) {
MERROR("Invalid ip_change_penalty transaction seen before network v12");
return false;
}
if (info.is_decommissioned()) {
LOG_PRINT_L2("Received reset position tx for service node " << key << " but it is already decommissioned; ignoring");
return false;
}
if (is_me)
MGINFO_RED("Reward position reset for service node (yours): " << key);
else
LOG_PRINT_L1("Reward position reset for service node: " << key);
// Move the SN at the back of the list as if it had just registered (or just won)
info.last_reward_block_height = block_height;
info.last_reward_transaction_index = std::numeric_limits<uint32_t>::max();
info.last_ip_change_height = block_height;
return true;
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
default:
// dev bug!
MERROR("BUG: Service node state change tx has unknown state " << static_cast<uint16_t>(state_change.state));
return false;
}
}
bool service_node_list::state_t::process_key_image_unlock_tx(cryptonote::network_type nettype, uint64_t block_height, const cryptonote::transaction &tx)
{
crypto::public_key snode_key;
if (!cryptonote::get_service_node_pubkey_from_tx_extra(tx.extra, snode_key))
return false;
auto it = service_nodes_infos.find(snode_key);
if (it == service_nodes_infos.end())
return false;
const service_node_info &node_info = *it->second;
if (node_info.requested_unlock_height != KEY_IMAGE_AWAITING_UNLOCK_HEIGHT)
{
LOG_PRINT_L1("Unlock TX: Node already requested an unlock at height: "
<< node_info.requested_unlock_height << " rejected on height: " << block_height
<< " for tx: " << cryptonote::get_transaction_hash(tx));
return false;
}
cryptonote::tx_extra_tx_key_image_unlock unlock;
if (!cryptonote::get_tx_key_image_unlock_from_tx_extra(tx.extra, unlock))
{
LOG_PRINT_L1("Unlock TX: Didn't have key image unlock in the tx_extra, rejected on height: "
<< block_height << " for tx: " << cryptonote::get_transaction_hash(tx));
return false;
}
uint64_t unlock_height = get_locked_key_image_unlock_height(nettype, node_info.registration_height, block_height);
for (const auto &contributor : node_info.contributors)
{
auto cit = std::find_if(contributor.locked_contributions.begin(),
contributor.locked_contributions.end(),
[&unlock](const service_node_info::contribution_t &contribution) {
return unlock.key_image == contribution.key_image;
});
if (cit != contributor.locked_contributions.end())
{
// NOTE(loki): This should be checked in blockchain check_tx_inputs already
crypto::hash const hash = service_nodes::generate_request_stake_unlock_hash(unlock.nonce);
if (crypto::check_signature(hash, cit->key_image_pub_key, unlock.signature))
{
duplicate_info(it->second).requested_unlock_height = unlock_height;
return true;
}
else
{
LOG_PRINT_L1("Unlock TX: Couldn't verify key image unlock in the tx_extra, rejected on height: "
<< block_height << " for tx: " << get_transaction_hash(tx));
return false;
}
}
}
return false;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
static bool get_contribution(cryptonote::network_type nettype, int hf_version, const cryptonote::transaction& tx, uint64_t block_height, parsed_tx_contribution &parsed_contribution)
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
if (!cryptonote::get_service_node_contributor_from_tx_extra(tx.extra, parsed_contribution.address))
return false;
if (!cryptonote::get_tx_secret_key_from_tx_extra(tx.extra, parsed_contribution.tx_key))
{
LOG_PRINT_L1("Contribution TX: There was a service node contributor but no secret key in the tx extra on height: " << block_height << " for tx: " << get_transaction_hash(tx));
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
return false;
}
crypto::key_derivation derivation;
if (!crypto::generate_key_derivation(parsed_contribution.address.m_view_public_key, parsed_contribution.tx_key, derivation))
{
LOG_PRINT_L1("Contribution TX: Failed to generate key derivation on height: " << block_height << " for tx: " << get_transaction_hash(tx));
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
return false;
}
hw::device& hwdev = hw::get_device("default");
parsed_contribution.transferred = 0;
if (hf_version >= cryptonote::network_version_11_infinite_staking)
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
cryptonote::tx_extra_tx_key_image_proofs key_image_proofs;
if (!get_tx_key_image_proofs_from_tx_extra(tx.extra, key_image_proofs))
{
LOG_PRINT_L1("Contribution TX: Didn't have key image proofs in the tx_extra, rejected on height: " << block_height << " for tx: " << get_transaction_hash(tx));
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
return false;
}
for (size_t output_index = 0; output_index < tx.vout.size(); ++output_index)
{
uint64_t transferred = get_reg_tx_staking_output_contribution(tx, output_index, derivation, hwdev);
if (transferred == 0)
continue;
crypto::public_key ephemeral_pub_key;
{
if (!hwdev.derive_public_key(derivation, output_index, parsed_contribution.address.m_spend_public_key, ephemeral_pub_key))
{
LOG_PRINT_L1("Contribution TX: Could not derive TX ephemeral key on height: " << block_height << " for tx: " << get_transaction_hash(tx) << " for output: " << output_index);
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
continue;
}
const auto& out_to_key = boost::get<cryptonote::txout_to_key>(tx.vout[output_index].target);
if (out_to_key.key != ephemeral_pub_key)
{
LOG_PRINT_L1("Contribution TX: Derived TX ephemeral key did not match tx stored key on height: " << block_height << " for tx: " << get_transaction_hash(tx) << " for output: " << output_index);
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
continue;
}
}
crypto::public_key const *ephemeral_pub_key_ptr = &ephemeral_pub_key;
for (auto proof = key_image_proofs.proofs.begin(); proof != key_image_proofs.proofs.end(); proof++)
{
if (!crypto::check_ring_signature((const crypto::hash &)(proof->key_image), proof->key_image, &ephemeral_pub_key_ptr, 1, &proof->signature))
continue;
parsed_contribution.locked_contributions.emplace_back(
service_node_info::version_0_checkpointing,
ephemeral_pub_key,
proof->key_image,
transferred
);
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
parsed_contribution.transferred += transferred;
key_image_proofs.proofs.erase(proof);
break;
}
}
}
else
{
for (size_t i = 0; i < tx.vout.size(); i++)
{
bool has_correct_unlock_time = false;
{
uint64_t unlock_time = tx.unlock_time;
Make tx type and version scoped enums This converts the transaction type and version to scoped enum, giving type safety and making the tx type assignment less error prone because there is no implicit conversion or comparison with raw integers that has to be worried about. This ends up converting any use of `cryptonote::transaction::type_xyz` to `cryptonote::transaction::txtype::xyz`. For version, names like `transaction::version_v4` become `cryptonote::txversion::v4_tx_types`. This also allows/includes various other simplifications related to or enabled by this change: - handle `is_deregister` dynamically in serialization code (setting `type::standard` or `type::deregister` rather than using a version-determined union) - `get_type()` is no longer needed with the above change: it is now much simpler to directly access `type` which will always have the correct value (even for v2 or v3 transaction types). And though there was an assertion on the enum value, `get_type()` was being used only sporadically: many places accessed `.type` directly. - the old unscoped enum didn't have a type but was assumed castable to/from `uint16_t`, which technically meant there was potential undefined behaviour when deserializing any type values >= 8. - tx type range checks weren't being done in all serialization paths; they are now. Because `get_type()` was not used everywhere (lots of places simply accessed `.type` directory) these might not have been caught. - `set_type()` is not needed; it was only being used in a single place (wallet2.cpp) and only for v4 txes, so the version protection code was never doing anything. - added a std::ostream << operator for the enum types so that they can be output with `<< tx_type <<` rather than needing to wrap it in `type_to_string(tx_type)` everywhere. For the versions, you get the annotated version string (e.g. 4_tx_types) rather than just the number 4.
2019-06-11 20:53:46 +02:00
if (tx.version >= cryptonote::txversion::v3_per_output_unlock_times)
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
unlock_time = tx.output_unlock_times[i];
uint64_t min_height = block_height + staking_num_lock_blocks(nettype);
has_correct_unlock_time = unlock_time < CRYPTONOTE_MAX_BLOCK_NUMBER && unlock_time >= min_height;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
if (has_correct_unlock_time)
parsed_contribution.transferred += get_reg_tx_staking_output_contribution(tx, i, derivation, hwdev);
}
}
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
return true;
Service Node Deregister Part 5 (#89) * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * core, service_node_list: separated address from service node pubkey * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * Store service node lists for the duration of deregister lifetimes * Quorum min/max bug, sort node list, fix node to test list * Change quorum to store acc pub address, fix oob bug * Code review for expiring votes, acc keys to pub_key, improve err msgs * Add early out for is_deregistration_tx and protect against quorum changes * Remove debug code, fix segfault * Remove irrelevant check for tx v3 in blockchain, fix >= height for pruning quorum states Incorrect assumption that a transaction can be kept in the chain if it could eventually become invalid, because if it were the chain would be split and eventually these transaction would be dropped. But also that we should not override the pre-existing logic which handles this case anyway.
2018-07-18 04:42:47 +02:00
}
bool is_registration_tx(cryptonote::network_type nettype, uint8_t hf_version, const cryptonote::transaction& tx, uint64_t block_timestamp, uint64_t block_height, uint32_t index, crypto::public_key& key, service_node_info& info)
2018-06-29 06:47:00 +02:00
{
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
crypto::public_key service_node_key;
std::vector<cryptonote::account_public_address> service_node_addresses;
std::vector<uint64_t> service_node_portions;
uint64_t portions_for_operator;
uint64_t expiration_timestamp;
crypto::signature signature;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
if (!reg_tx_extract_fields(tx, service_node_addresses, portions_for_operator, service_node_portions, expiration_timestamp, service_node_key, signature))
return false;
if (service_node_portions.size() != service_node_addresses.size() || service_node_portions.empty())
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
LOG_PRINT_L1("Register TX: Extracted portions size: (" << service_node_portions.size() <<
") was empty or did not match address size: (" << service_node_addresses.size() <<
") on height: " << block_height <<
" for tx: " << cryptonote::get_transaction_hash(tx));
return false;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
if (!check_service_node_portions(hf_version, service_node_portions)) return false;
2018-06-29 06:47:00 +02:00
if (portions_for_operator > STAKING_PORTIONS)
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
LOG_PRINT_L1("Register TX: Operator portions: " << portions_for_operator <<
" exceeded staking portions: " << STAKING_PORTIONS <<
" on height: " << block_height <<
" for tx: " << cryptonote::get_transaction_hash(tx));
return false;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
2018-08-06 15:08:44 +02:00
// check the signature is all good
crypto::hash hash;
if (!get_registration_hash(service_node_addresses, portions_for_operator, service_node_portions, expiration_timestamp, hash))
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
LOG_PRINT_L1("Register TX: Failed to extract registration hash, on height: " << block_height << " for tx: " << cryptonote::get_transaction_hash(tx));
return false;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
if (!crypto::check_key(service_node_key) || !crypto::check_signature(hash, service_node_key, signature))
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
LOG_PRINT_L1("Register TX: Has invalid key and/or signature, on height: " << block_height << " for tx: " << cryptonote::get_transaction_hash(tx));
return false;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
if (expiration_timestamp < block_timestamp)
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
LOG_PRINT_L1("Register TX: Has expired. The block timestamp: " << block_timestamp <<
" is greater than the expiration timestamp: " << expiration_timestamp <<
" on height: " << block_height <<
" for tx:" << cryptonote::get_transaction_hash(tx));
return false;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
2018-06-29 06:47:00 +02:00
2018-08-06 15:08:44 +02:00
// check the initial contribution exists
info.staking_requirement = get_staking_requirement(nettype, block_height, hf_version);
2018-08-06 15:08:44 +02:00
cryptonote::account_public_address address;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
parsed_tx_contribution parsed_contribution = {};
if (!get_contribution(nettype, hf_version, tx, block_height, parsed_contribution))
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
LOG_PRINT_L1("Register TX: Had service node registration fields, but could not decode contribution on height: " << block_height << " for tx: " << cryptonote::get_transaction_hash(tx));
2018-08-06 15:08:44 +02:00
return false;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
Infinite Staking Part 2 (#406) * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add command to print locked key images * Update ui to display lock stakes, query in print cmd blacklist * Modify print stakes to be less slow * Remove autostaking code * Refactor staking into sweep functions It appears staking was derived off stake_main written separately at implementation at the beginning. This merges them back into a common code path, after removing autostake there's only some minor differences. It also makes sure that any changes to sweeping upstream are going to be considered in the staking process which we want. * Display unlock height for stakes * Begin creating output blacklist * Make blacklist output a migration step * Implement get_output_blacklist for lmdb * In wallet output selection ignore blacklisted outputs * Apply blacklisted outputs to output selection * Fix broken tests, switch key image unlock * Fix broken unit_tests * Begin change to limit locked key images to 4 globally * Revamp prepare registration for new min contribution rules * Fix up old back case in prepare registration * Remove debug code * Cleanup debug code and some unecessary changes * Fix migration step on mainnet db * Fix blacklist outputs for pre-existing DB's * Remove irrelevant note * Tweak scanning addresses for locked stakes Since we only now allow contributions from the primary address we can skip checking all subaddress + lookahead to speed up wallet scanning * Define macro for SCNu64 for Mingw * Fix failure on empty DB * Add missing error msg, remove contributor from stake * Improve staking messages * Flush prompt to always display * Return the msg from stake failure and fix stake parsing error * Tweak fork rules for smaller bulletproofs * Tweak pooled nodes minimum amounts * Fix crash on exit, there's no need to store on destructor Since all information about service nodes is derived from the blockchain and we store state every time we receive a block, storing in the destructor is redundant as there is no new information to store. * Make prompt be consistent with CLI * Check max number of key images from per user to node * Implement error message on get_output_blacklist failure * Remove resolved TODO's/comments * Handle infinite staking in print_sn * Atoi->strtol, fix prepare_registration, virtual override, stale msgs
2019-02-14 02:12:57 +01:00
const uint64_t min_transfer = get_min_node_contribution(hf_version, info.staking_requirement, info.total_reserved, info.total_num_locked_contributions());
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
if (parsed_contribution.transferred < min_transfer)
{
LOG_PRINT_L1("Register TX: Contribution transferred: " << parsed_contribution.transferred << " didn't meet the minimum transfer requirement: " << min_transfer << " on height: " << block_height << " for tx: " << cryptonote::get_transaction_hash(tx));
2018-08-06 15:08:44 +02:00
return false;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
size_t total_num_of_addr = service_node_addresses.size();
if (std::find(service_node_addresses.begin(), service_node_addresses.end(), parsed_contribution.address) == service_node_addresses.end())
total_num_of_addr++;
if (total_num_of_addr > MAX_NUMBER_OF_CONTRIBUTORS)
{
LOG_PRINT_L1("Register TX: Number of participants: " << total_num_of_addr <<
" exceeded the max number of contributors: " << MAX_NUMBER_OF_CONTRIBUTORS <<
" on height: " << block_height <<
" for tx: " << cryptonote::get_transaction_hash(tx));
return false;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
2018-08-06 15:08:44 +02:00
// don't actually process this contribution now, do it when we fall through later.
key = service_node_key;
info.operator_address = service_node_addresses[0];
info.portions_for_operator = portions_for_operator;
info.registration_height = block_height;
info.registration_hf_version = hf_version;
info.last_reward_block_height = block_height;
info.last_reward_transaction_index = index;
info.active_since_height = 0;
info.last_decommission_height = 0;
info.decommission_count = 0;
info.total_contributed = 0;
info.total_reserved = 0;
info.swarm_id = UNASSIGNED_SWARM_ID;
info.proof->public_ip = 0;
info.proof->storage_port = 0;
info.last_ip_change_height = block_height;
info.version = get_min_service_node_info_version_for_hf(hf_version);
2018-08-06 15:08:44 +02:00
info.contributors.clear();
for (size_t i = 0; i < service_node_addresses.size(); i++)
{
// Check for duplicates
auto iter = std::find(service_node_addresses.begin(), service_node_addresses.begin() + i, service_node_addresses[i]);
if (iter != service_node_addresses.begin() + i)
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
LOG_PRINT_L1("Register TX: There was a duplicate participant for service node on height: " << block_height << " for tx: " << cryptonote::get_transaction_hash(tx));
2018-08-06 15:08:44 +02:00
return false;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
2018-08-06 15:08:44 +02:00
uint64_t hi, lo, resulthi, resultlo;
lo = mul128(info.staking_requirement, service_node_portions[i], &hi);
div128_64(hi, lo, STAKING_PORTIONS, &resulthi, &resultlo);
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
info.contributors.emplace_back();
auto &contributor = info.contributors.back();
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
contributor.reserved = resultlo;
contributor.address = service_node_addresses[i];
info.total_reserved += resultlo;
2018-08-06 15:08:44 +02:00
}
return true;
}
bool service_node_list::state_t::process_registration_tx(cryptonote::network_type nettype, const cryptonote::block &block, const cryptonote::transaction& tx, uint32_t index, crypto::public_key const *my_pubkey)
{
uint8_t const hf_version = block.major_version;
uint64_t const block_timestamp = block.timestamp;
uint64_t const block_height = cryptonote::get_block_height(block);
crypto::public_key key;
Use shared_ptr storage for service_node_info This converts the stored service_node_info value into a `shared_ptr<const service_node_info>` rather than a plain `service_node_info`. This yields a huge performance benefit by significantly eliminating the vast majority of service_node_info construction, destruction, and copying. Most of the time when we copy a service_node_info nothing in it has changed, which means we're storing exactly the same thing; this means an extra construction for every SN info on every block *and* an extra destruction when we cull old stored history. By using a shared_ptr, the vast majority of those constructions and destructions are eliminated. The immediately previous commit (upon which this one builds) already reduced a full rescan from 180s to 171s; this commit further reduces that time to 104s, or about 42% reduced from the rescan time required before this pair of commits. (All timings are from the dev.lokinet.org box, tested over multiple runs with the entire lmdb cached in memory). With the shared_ptr approach, we only make a copy when a change is actually needed: because of infrequent (at the per-SN level) events like a state_change, received reward, contribution, etc. The contained reference is deliberately `const` so that values are not changeable; there's a new function that does an explicit copying duplication, returning the new non-const and storing the const ref in the shared pointer. Related to this is a small change (and fix) to how proof info and public_ip/storage_port are stored: rather than store the values in the service_node_info struct itself, they now gets stored in a shared_ptr inside the service_node_info that intentionally gets shared among all copies of the service_node_info (that is, a SN info copy deliberately copies the pointer rather than the values). This also moves the ip/port values into the proof struct, since that seemed much easier than maintaining a separate shared_ptr for each value. Previously, because these were stored as values in the service_node_info they would actually get rolled back in the event of a reorg, but that seems highly undesirable: you would end up rolling back to the old values of the uptime proof and ip address (for example), but that should not happen: those values are not dependent on the blockchain and so should not be affected by a reorg/rollback. With this change they aren't since there is only one actual proof stored. Note that the shared storage here only applies to in-memory states; states loaded from the db will still be duplicated.
2019-08-11 18:19:24 +02:00
auto info_ptr = std::make_shared<service_node_info>();
service_node_info &info = *info_ptr;
if (!is_registration_tx(nettype, hf_version, tx, block_timestamp, block_height, index, key, info))
return false;
if (hf_version >= cryptonote::network_version_11_infinite_staking)
{
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
// NOTE(loki): Grace period is not used anymore with infinite staking. So, if someone somehow reregisters, we just ignore it
const auto iter = service_nodes_infos.find(key);
if (iter != service_nodes_infos.end())
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
return false;
if (my_pubkey && *my_pubkey == key) MGINFO_GREEN("Service node registered (yours): " << key << " on height: " << block_height);
else LOG_PRINT_L1("New service node registered: " << key << " on height: " << block_height);
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
else
{
// NOTE: A node doesn't expire until registration_height + lock blocks excess now which acts as the grace period
// So it is possible to find the node still in our list.
bool registered_during_grace_period = false;
const auto iter = service_nodes_infos.find(key);
if (iter != service_nodes_infos.end())
{
if (hf_version >= cryptonote::network_version_10_bulletproofs)
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
Use shared_ptr storage for service_node_info This converts the stored service_node_info value into a `shared_ptr<const service_node_info>` rather than a plain `service_node_info`. This yields a huge performance benefit by significantly eliminating the vast majority of service_node_info construction, destruction, and copying. Most of the time when we copy a service_node_info nothing in it has changed, which means we're storing exactly the same thing; this means an extra construction for every SN info on every block *and* an extra destruction when we cull old stored history. By using a shared_ptr, the vast majority of those constructions and destructions are eliminated. The immediately previous commit (upon which this one builds) already reduced a full rescan from 180s to 171s; this commit further reduces that time to 104s, or about 42% reduced from the rescan time required before this pair of commits. (All timings are from the dev.lokinet.org box, tested over multiple runs with the entire lmdb cached in memory). With the shared_ptr approach, we only make a copy when a change is actually needed: because of infrequent (at the per-SN level) events like a state_change, received reward, contribution, etc. The contained reference is deliberately `const` so that values are not changeable; there's a new function that does an explicit copying duplication, returning the new non-const and storing the const ref in the shared pointer. Related to this is a small change (and fix) to how proof info and public_ip/storage_port are stored: rather than store the values in the service_node_info struct itself, they now gets stored in a shared_ptr inside the service_node_info that intentionally gets shared among all copies of the service_node_info (that is, a SN info copy deliberately copies the pointer rather than the values). This also moves the ip/port values into the proof struct, since that seemed much easier than maintaining a separate shared_ptr for each value. Previously, because these were stored as values in the service_node_info they would actually get rolled back in the event of a reorg, but that seems highly undesirable: you would end up rolling back to the old values of the uptime proof and ip address (for example), but that should not happen: those values are not dependent on the blockchain and so should not be affected by a reorg/rollback. With this change they aren't since there is only one actual proof stored. Note that the shared storage here only applies to in-memory states; states loaded from the db will still be duplicated.
2019-08-11 18:19:24 +02:00
service_node_info const &old_info = *iter->second;
uint64_t expiry_height = old_info.registration_height + staking_num_lock_blocks(nettype);
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
if (block_height < expiry_height)
return false;
// NOTE: Node preserves its position in list if it reregisters during grace period.
registered_during_grace_period = true;
info.last_reward_block_height = old_info.last_reward_block_height;
info.last_reward_transaction_index = old_info.last_reward_transaction_index;
}
else
{
return false;
}
}
if (my_pubkey && *my_pubkey == key)
{
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
if (registered_during_grace_period)
{
MGINFO_GREEN("Service node re-registered (yours): " << key << " at block height: " << block_height);
}
else
{
MGINFO_GREEN("Service node registered (yours): " << key << " at block height: " << block_height);
}
}
else
{
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
LOG_PRINT_L1("New service node registered: " << key << " at block height: " << block_height);
}
}
service_nodes_infos[key] = std::move(info_ptr);
2018-08-06 15:08:44 +02:00
return true;
}
bool service_node_list::state_t::process_contribution_tx(cryptonote::network_type nettype, const cryptonote::block &block, const cryptonote::transaction& tx, uint32_t index)
{
uint64_t const block_height = cryptonote::get_block_height(block);
uint8_t const hf_version = block.major_version;
crypto::public_key pubkey;
if (!cryptonote::get_service_node_pubkey_from_tx_extra(tx.extra, pubkey))
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
return false; // Is not a contribution TX don't need to check it.
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
parsed_tx_contribution parsed_contribution = {};
if (!get_contribution(nettype, hf_version, tx, block_height, parsed_contribution))
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
LOG_PRINT_L1("Contribution TX: Could not decode contribution for service node: " << pubkey << " on height: " << block_height << " for tx: " << cryptonote::get_transaction_hash(tx));
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
return false;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
auto iter = service_nodes_infos.find(pubkey);
if (iter == service_nodes_infos.end())
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
LOG_PRINT_L1("Contribution TX: Contribution received for service node: " << pubkey <<
", but could not be found in the service node list on height: " << block_height <<
" for tx: " << cryptonote::get_transaction_hash(tx )<< "\n"
"This could mean that the service node was deregistered before the contribution was processed.");
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
return false;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
Use shared_ptr storage for service_node_info This converts the stored service_node_info value into a `shared_ptr<const service_node_info>` rather than a plain `service_node_info`. This yields a huge performance benefit by significantly eliminating the vast majority of service_node_info construction, destruction, and copying. Most of the time when we copy a service_node_info nothing in it has changed, which means we're storing exactly the same thing; this means an extra construction for every SN info on every block *and* an extra destruction when we cull old stored history. By using a shared_ptr, the vast majority of those constructions and destructions are eliminated. The immediately previous commit (upon which this one builds) already reduced a full rescan from 180s to 171s; this commit further reduces that time to 104s, or about 42% reduced from the rescan time required before this pair of commits. (All timings are from the dev.lokinet.org box, tested over multiple runs with the entire lmdb cached in memory). With the shared_ptr approach, we only make a copy when a change is actually needed: because of infrequent (at the per-SN level) events like a state_change, received reward, contribution, etc. The contained reference is deliberately `const` so that values are not changeable; there's a new function that does an explicit copying duplication, returning the new non-const and storing the const ref in the shared pointer. Related to this is a small change (and fix) to how proof info and public_ip/storage_port are stored: rather than store the values in the service_node_info struct itself, they now gets stored in a shared_ptr inside the service_node_info that intentionally gets shared among all copies of the service_node_info (that is, a SN info copy deliberately copies the pointer rather than the values). This also moves the ip/port values into the proof struct, since that seemed much easier than maintaining a separate shared_ptr for each value. Previously, because these were stored as values in the service_node_info they would actually get rolled back in the event of a reorg, but that seems highly undesirable: you would end up rolling back to the old values of the uptime proof and ip address (for example), but that should not happen: those values are not dependent on the blockchain and so should not be affected by a reorg/rollback. With this change they aren't since there is only one actual proof stored. Note that the shared storage here only applies to in-memory states; states loaded from the db will still be duplicated.
2019-08-11 18:19:24 +02:00
const service_node_info& curinfo = *iter->second;
if (curinfo.is_fully_funded())
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
LOG_PRINT_L1("Contribution TX: Service node: " << pubkey <<
" is already fully funded, but contribution received on height: " << block_height <<
" for tx: " << cryptonote::get_transaction_hash(tx));
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
return false;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
if (!cryptonote::get_tx_secret_key_from_tx_extra(tx.extra, parsed_contribution.tx_key))
{
LOG_PRINT_L1("Contribution TX: Failed to get tx secret key from contribution received on height: " << block_height << " for tx: " << cryptonote::get_transaction_hash(tx));
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
return false;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
Use shared_ptr storage for service_node_info This converts the stored service_node_info value into a `shared_ptr<const service_node_info>` rather than a plain `service_node_info`. This yields a huge performance benefit by significantly eliminating the vast majority of service_node_info construction, destruction, and copying. Most of the time when we copy a service_node_info nothing in it has changed, which means we're storing exactly the same thing; this means an extra construction for every SN info on every block *and* an extra destruction when we cull old stored history. By using a shared_ptr, the vast majority of those constructions and destructions are eliminated. The immediately previous commit (upon which this one builds) already reduced a full rescan from 180s to 171s; this commit further reduces that time to 104s, or about 42% reduced from the rescan time required before this pair of commits. (All timings are from the dev.lokinet.org box, tested over multiple runs with the entire lmdb cached in memory). With the shared_ptr approach, we only make a copy when a change is actually needed: because of infrequent (at the per-SN level) events like a state_change, received reward, contribution, etc. The contained reference is deliberately `const` so that values are not changeable; there's a new function that does an explicit copying duplication, returning the new non-const and storing the const ref in the shared pointer. Related to this is a small change (and fix) to how proof info and public_ip/storage_port are stored: rather than store the values in the service_node_info struct itself, they now gets stored in a shared_ptr inside the service_node_info that intentionally gets shared among all copies of the service_node_info (that is, a SN info copy deliberately copies the pointer rather than the values). This also moves the ip/port values into the proof struct, since that seemed much easier than maintaining a separate shared_ptr for each value. Previously, because these were stored as values in the service_node_info they would actually get rolled back in the event of a reorg, but that seems highly undesirable: you would end up rolling back to the old values of the uptime proof and ip address (for example), but that should not happen: those values are not dependent on the blockchain and so should not be affected by a reorg/rollback. With this change they aren't since there is only one actual proof stored. Note that the shared storage here only applies to in-memory states; states loaded from the db will still be duplicated.
2019-08-11 18:19:24 +02:00
auto &info = duplicate_info(iter->second);
auto &contributors = info.contributors;
2018-08-06 15:08:44 +02:00
auto contrib_iter = std::find_if(contributors.begin(), contributors.end(),
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
[&parsed_contribution](const service_node_info::contributor_t& contributor) { return contributor.address == parsed_contribution.address; });
const bool new_contributor = (contrib_iter == contributors.end());
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
if (new_contributor)
{
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
if (contributors.size() >= MAX_NUMBER_OF_CONTRIBUTORS)
{
LOG_PRINT_L1("Contribution TX: Node is full with max contributors: " << MAX_NUMBER_OF_CONTRIBUTORS <<
" for service node: " << pubkey <<
" on height: " << block_height <<
" for tx: " << cryptonote::get_transaction_hash(tx));
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
return false;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
/// Check that the contribution is large enough
Infinite Staking Part 2 (#406) * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add command to print locked key images * Update ui to display lock stakes, query in print cmd blacklist * Modify print stakes to be less slow * Remove autostaking code * Refactor staking into sweep functions It appears staking was derived off stake_main written separately at implementation at the beginning. This merges them back into a common code path, after removing autostake there's only some minor differences. It also makes sure that any changes to sweeping upstream are going to be considered in the staking process which we want. * Display unlock height for stakes * Begin creating output blacklist * Make blacklist output a migration step * Implement get_output_blacklist for lmdb * In wallet output selection ignore blacklisted outputs * Apply blacklisted outputs to output selection * Fix broken tests, switch key image unlock * Fix broken unit_tests * Begin change to limit locked key images to 4 globally * Revamp prepare registration for new min contribution rules * Fix up old back case in prepare registration * Remove debug code * Cleanup debug code and some unecessary changes * Fix migration step on mainnet db * Fix blacklist outputs for pre-existing DB's * Remove irrelevant note * Tweak scanning addresses for locked stakes Since we only now allow contributions from the primary address we can skip checking all subaddress + lookahead to speed up wallet scanning * Define macro for SCNu64 for Mingw * Fix failure on empty DB * Add missing error msg, remove contributor from stake * Improve staking messages * Flush prompt to always display * Return the msg from stake failure and fix stake parsing error * Tweak fork rules for smaller bulletproofs * Tweak pooled nodes minimum amounts * Fix crash on exit, there's no need to store on destructor Since all information about service nodes is derived from the blockchain and we store state every time we receive a block, storing in the destructor is redundant as there is no new information to store. * Make prompt be consistent with CLI * Check max number of key images from per user to node * Implement error message on get_output_blacklist failure * Remove resolved TODO's/comments * Handle infinite staking in print_sn * Atoi->strtol, fix prepare_registration, virtual override, stale msgs
2019-02-14 02:12:57 +01:00
const uint64_t min_contribution = get_min_node_contribution(hf_version, info.staking_requirement, info.total_reserved, info.total_num_locked_contributions());
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
if (parsed_contribution.transferred < min_contribution)
{
LOG_PRINT_L1("Contribution TX: Amount " << parsed_contribution.transferred <<
" did not meet min " << min_contribution <<
" for service node: " << pubkey <<
" on height: " << block_height <<
" for tx: " << cryptonote::get_transaction_hash(tx));
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
return false;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
2018-06-29 06:47:00 +02:00
//
// Successfully Validated
//
contrib_iter = info.contributors.emplace(contributors.end());
contrib_iter->address = parsed_contribution.address;
}
2018-06-29 06:47:00 +02:00
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
service_node_info::contributor_t& contributor = *contrib_iter;
2018-06-29 06:47:00 +02:00
2018-08-06 15:08:44 +02:00
// In this action, we cannot
// increase total_reserved so much that it is >= staking_requirement
uint64_t can_increase_reserved_by = info.staking_requirement - info.total_reserved;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
uint64_t max_amount = contributor.reserved + can_increase_reserved_by;
parsed_contribution.transferred = std::min(max_amount - contributor.amount, parsed_contribution.transferred);
2018-06-29 06:47:00 +02:00
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
contributor.amount += parsed_contribution.transferred;
info.total_contributed += parsed_contribution.transferred;
2018-08-06 15:08:44 +02:00
if (contributor.amount > contributor.reserved)
{
info.total_reserved += contributor.amount - contributor.reserved;
contributor.reserved = contributor.amount;
}
2018-06-29 06:47:00 +02:00
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
info.last_reward_block_height = block_height;
info.last_reward_transaction_index = index;
Infinite Staking Part 2 (#406) * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add command to print locked key images * Update ui to display lock stakes, query in print cmd blacklist * Modify print stakes to be less slow * Remove autostaking code * Refactor staking into sweep functions It appears staking was derived off stake_main written separately at implementation at the beginning. This merges them back into a common code path, after removing autostake there's only some minor differences. It also makes sure that any changes to sweeping upstream are going to be considered in the staking process which we want. * Display unlock height for stakes * Begin creating output blacklist * Make blacklist output a migration step * Implement get_output_blacklist for lmdb * In wallet output selection ignore blacklisted outputs * Apply blacklisted outputs to output selection * Fix broken tests, switch key image unlock * Fix broken unit_tests * Begin change to limit locked key images to 4 globally * Revamp prepare registration for new min contribution rules * Fix up old back case in prepare registration * Remove debug code * Cleanup debug code and some unecessary changes * Fix migration step on mainnet db * Fix blacklist outputs for pre-existing DB's * Remove irrelevant note * Tweak scanning addresses for locked stakes Since we only now allow contributions from the primary address we can skip checking all subaddress + lookahead to speed up wallet scanning * Define macro for SCNu64 for Mingw * Fix failure on empty DB * Add missing error msg, remove contributor from stake * Improve staking messages * Flush prompt to always display * Return the msg from stake failure and fix stake parsing error * Tweak fork rules for smaller bulletproofs * Tweak pooled nodes minimum amounts * Fix crash on exit, there's no need to store on destructor Since all information about service nodes is derived from the blockchain and we store state every time we receive a block, storing in the destructor is redundant as there is no new information to store. * Make prompt be consistent with CLI * Check max number of key images from per user to node * Implement error message on get_output_blacklist failure * Remove resolved TODO's/comments * Handle infinite staking in print_sn * Atoi->strtol, fix prepare_registration, virtual override, stale msgs
2019-02-14 02:12:57 +01:00
const size_t max_contributions_per_node = service_nodes::MAX_KEY_IMAGES_PER_CONTRIBUTOR * MAX_NUMBER_OF_CONTRIBUTORS;
if (hf_version >= cryptonote::network_version_11_infinite_staking)
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
for (const service_node_info::contribution_t &contribution : parsed_contribution.locked_contributions)
Infinite Staking Part 2 (#406) * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add command to print locked key images * Update ui to display lock stakes, query in print cmd blacklist * Modify print stakes to be less slow * Remove autostaking code * Refactor staking into sweep functions It appears staking was derived off stake_main written separately at implementation at the beginning. This merges them back into a common code path, after removing autostake there's only some minor differences. It also makes sure that any changes to sweeping upstream are going to be considered in the staking process which we want. * Display unlock height for stakes * Begin creating output blacklist * Make blacklist output a migration step * Implement get_output_blacklist for lmdb * In wallet output selection ignore blacklisted outputs * Apply blacklisted outputs to output selection * Fix broken tests, switch key image unlock * Fix broken unit_tests * Begin change to limit locked key images to 4 globally * Revamp prepare registration for new min contribution rules * Fix up old back case in prepare registration * Remove debug code * Cleanup debug code and some unecessary changes * Fix migration step on mainnet db * Fix blacklist outputs for pre-existing DB's * Remove irrelevant note * Tweak scanning addresses for locked stakes Since we only now allow contributions from the primary address we can skip checking all subaddress + lookahead to speed up wallet scanning * Define macro for SCNu64 for Mingw * Fix failure on empty DB * Add missing error msg, remove contributor from stake * Improve staking messages * Flush prompt to always display * Return the msg from stake failure and fix stake parsing error * Tweak fork rules for smaller bulletproofs * Tweak pooled nodes minimum amounts * Fix crash on exit, there's no need to store on destructor Since all information about service nodes is derived from the blockchain and we store state every time we receive a block, storing in the destructor is redundant as there is no new information to store. * Make prompt be consistent with CLI * Check max number of key images from per user to node * Implement error message on get_output_blacklist failure * Remove resolved TODO's/comments * Handle infinite staking in print_sn * Atoi->strtol, fix prepare_registration, virtual override, stale msgs
2019-02-14 02:12:57 +01:00
{
if (info.total_num_locked_contributions() < max_contributions_per_node)
contributor.locked_contributions.push_back(contribution);
else
{
LOG_PRINT_L1("Contribution TX: Already hit the max number of contributions: " << max_contributions_per_node <<
" for contributor: " << cryptonote::get_account_address_as_str(nettype, false, contributor.address) <<
Infinite Staking Part 2 (#406) * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add command to print locked key images * Update ui to display lock stakes, query in print cmd blacklist * Modify print stakes to be less slow * Remove autostaking code * Refactor staking into sweep functions It appears staking was derived off stake_main written separately at implementation at the beginning. This merges them back into a common code path, after removing autostake there's only some minor differences. It also makes sure that any changes to sweeping upstream are going to be considered in the staking process which we want. * Display unlock height for stakes * Begin creating output blacklist * Make blacklist output a migration step * Implement get_output_blacklist for lmdb * In wallet output selection ignore blacklisted outputs * Apply blacklisted outputs to output selection * Fix broken tests, switch key image unlock * Fix broken unit_tests * Begin change to limit locked key images to 4 globally * Revamp prepare registration for new min contribution rules * Fix up old back case in prepare registration * Remove debug code * Cleanup debug code and some unecessary changes * Fix migration step on mainnet db * Fix blacklist outputs for pre-existing DB's * Remove irrelevant note * Tweak scanning addresses for locked stakes Since we only now allow contributions from the primary address we can skip checking all subaddress + lookahead to speed up wallet scanning * Define macro for SCNu64 for Mingw * Fix failure on empty DB * Add missing error msg, remove contributor from stake * Improve staking messages * Flush prompt to always display * Return the msg from stake failure and fix stake parsing error * Tweak fork rules for smaller bulletproofs * Tweak pooled nodes minimum amounts * Fix crash on exit, there's no need to store on destructor Since all information about service nodes is derived from the blockchain and we store state every time we receive a block, storing in the destructor is redundant as there is no new information to store. * Make prompt be consistent with CLI * Check max number of key images from per user to node * Implement error message on get_output_blacklist failure * Remove resolved TODO's/comments * Handle infinite staking in print_sn * Atoi->strtol, fix prepare_registration, virtual override, stale msgs
2019-02-14 02:12:57 +01:00
" on height: " << block_height <<
" for tx: " << cryptonote::get_transaction_hash(tx));
break;
}
}
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
LOG_PRINT_L1("Contribution of " << parsed_contribution.transferred << " received for service node " << pubkey);
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
if (info.is_fully_funded()) {
info.active_since_height = block_height;
return true;
}
return false;
}
2018-06-29 06:47:00 +02:00
bool service_node_list::block_added(const cryptonote::block& block, const std::vector<cryptonote::transaction>& txs, cryptonote::checkpoint_t const *checkpoint)
{
if (block.major_version < cryptonote::network_version_9_service_nodes)
return true;
std::lock_guard<boost::recursive_mutex> lock(m_sn_mutex);
process_block(block, txs);
if (block.major_version >= cryptonote::network_version_13_enforce_checkpoints && checkpoint)
{
std::shared_ptr<const testing_quorum> quorum = get_testing_quorum(quorum_type::checkpointing, checkpoint->height);
if (!quorum)
{
LOG_PRINT_L1("Failed to get testing quorum checkpoint for block: " << cryptonote::get_block_hash(block));
return false;
}
if (!service_nodes::verify_checkpoint(block.major_version, *checkpoint, *quorum))
{
LOG_PRINT_L1("Service node checkpoint failed verification for block: " << cryptonote::get_block_hash(block));
return false;
}
}
store();
return true;
2018-06-29 06:47:00 +02:00
}
static std::vector<size_t> generate_shuffled_service_node_index_list(
size_t list_size,
crypto::hash const &block_hash,
quorum_type type,
size_t sublist_size = 0,
size_t sublist_up_to = 0)
{
std::vector<size_t> result(list_size);
std::iota(result.begin(), result.end(), 0);
uint64_t seed = 0;
std::memcpy(&seed, block_hash.data, std::min(sizeof(seed), sizeof(block_hash.data)));
boost::endian::little_to_native_inplace(seed);
seed += static_cast<uint64_t>(type);
// Shuffle 2
// |=================================|
// | |
// Shuffle 1 |
// |==============| |
// | | | |
// |sublist_size | |
// | | sublist_up_to |
// 0 N Y Z
// [.......................................]
// If we have a list [0,Z) but we need a shuffled sublist of the first N values that only
// includes values from [0,Y) then we do this using two shuffles: first of the [0,Y) sublist,
// then of the [N,Z) sublist (which is already partially shuffled, but that doesn't matter). We
// reuse the same seed for both partial shuffles, but again, that isn't an issue.
if ((0 < sublist_size && sublist_size < list_size) && (0 < sublist_up_to && sublist_up_to < list_size)) {
assert(sublist_size <= sublist_up_to); // Can't select N random items from M items when M < N
loki_shuffle(result.begin(), result.begin() + sublist_up_to, seed);
loki_shuffle(result.begin() + sublist_size, result.end(), seed);
}
else {
loki_shuffle(result.begin(), result.end(), seed);
}
return result;
}
static quorum_manager generate_quorums(cryptonote::network_type nettype, uint8_t hf_version, service_node_list::state_t const &state)
{
quorum_manager result = {};
assert(state.block_hash != crypto::null_hash);
// The two quorums here have different selection criteria: the entire checkpoint quorum and the
// state change *validators* want only active service nodes, but the state change *workers*
// (i.e. the nodes to be tested) also include decommissioned service nodes. (Prior to v12 there
// are no decommissioned nodes, so this distinction is irrelevant for network concensus).
auto active_snode_list = state.active_service_nodes_infos();
decltype(active_snode_list) decomm_snode_list;
if (hf_version >= cryptonote::network_version_12_checkpointing)
decomm_snode_list = state.decommissioned_service_nodes_infos();
quorum_type const max_quorum_type = max_quorum_type_for_hf(hf_version);
for (int type_int = 0; type_int <= (int)max_quorum_type; type_int++)
{
auto type = static_cast<quorum_type>(type_int);
size_t num_validators = 0, num_workers = 0;
auto quorum = std::make_shared<testing_quorum>();
std::vector<size_t> pub_keys_indexes;
if (type == quorum_type::obligations)
{
size_t total_nodes = active_snode_list.size() + decomm_snode_list.size();
num_validators = std::min(active_snode_list.size(), STATE_CHANGE_QUORUM_SIZE);
pub_keys_indexes = generate_shuffled_service_node_index_list(total_nodes, state.block_hash, type, num_validators, active_snode_list.size());
result.obligations = quorum;
size_t num_remaining_nodes = total_nodes - num_validators;
num_workers = std::min(num_remaining_nodes, std::max(STATE_CHANGE_MIN_NODES_TO_TEST, num_remaining_nodes/STATE_CHANGE_NTH_OF_THE_NETWORK_TO_TEST));
}
else if (type == quorum_type::checkpointing)
{
// Checkpoint quorums only exist every CHECKPOINT_INTERVAL blocks, but the height that gets
// used to generate the quorum (i.e. the `height` variable here) is actually `H -
// REORG_SAFETY_BUFFER_BLOCKS_POST_HF12`, where H is divisible by CHECKPOINT_INTERVAL, but
// REORG_SAFETY_BUFFER_BLOCKS_POST_HF12 is not (it equals 11). Hence the addition here to
// "undo" the lag before checking to see if we're on an interval multiple:
if ((state.height + REORG_SAFETY_BUFFER_BLOCKS_POST_HF12) % CHECKPOINT_INTERVAL != 0)
continue; // Not on an interval multiple: no checkpointing quorum is defined.
size_t total_nodes = active_snode_list.size();
// TODO(loki): Soft fork, remove when testnet gets reset
if (nettype == cryptonote::TESTNET && state.height < 85357)
total_nodes = active_snode_list.size() + decomm_snode_list.size();
// TODO(loki): We can remove after switching to V13 since we delete all V12 and below checkpoints where we introduced this kind of quorum
if (hf_version >= cryptonote::network_version_13_enforce_checkpoints && total_nodes < CHECKPOINT_QUORUM_SIZE)
continue;
pub_keys_indexes = generate_shuffled_service_node_index_list(total_nodes, state.block_hash, type);
result.checkpointing = quorum;
if ((state.height + REORG_SAFETY_BUFFER_BLOCKS_POST_HF12) >= hf13_height)
num_validators = std::min(pub_keys_indexes.size(), CHECKPOINT_QUORUM_SIZE);
else
num_workers = std::min(pub_keys_indexes.size(), CHECKPOINT_QUORUM_SIZE);
}
else
{
MERROR("Unhandled quorum type enum with value: " << type_int);
continue;
}
quorum->validators.reserve(num_validators);
quorum->workers.reserve(num_workers);
size_t i = 0;
for (; i < num_validators; i++)
{
quorum->validators.push_back(active_snode_list[pub_keys_indexes[i]].first);
}
for (; i < num_validators + num_workers; i++)
{
size_t j = pub_keys_indexes[i];
if (j < active_snode_list.size())
quorum->workers.push_back(active_snode_list[j].first);
else
quorum->workers.push_back(decomm_snode_list[j - active_snode_list.size()].first);
}
}
return result;
}
void service_node_list::state_t::update_from_block(cryptonote::BlockchainDB const &db,
cryptonote::network_type nettype,
std::set<state_t> const &state_history,
std::unordered_map<crypto::hash, state_t> const &alt_states,
const cryptonote::block &block,
const std::vector<cryptonote::transaction> &txs,
crypto::public_key const *my_pubkey)
2018-06-29 06:47:00 +02:00
{
++height;
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
bool need_swarm_update = false;
uint64_t block_height = cryptonote::get_block_height(block);
assert(height == block_height);
quorums = {};
block_hash = cryptonote::get_block_hash(block);
uint8_t const hf_version = block.major_version;
2018-06-29 06:47:00 +02:00
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
//
// Remove expired blacklisted key images
//
2019-09-09 03:14:19 +02:00
if (hf_version >= cryptonote::network_version_11_infinite_staking)
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
for (auto entry = key_image_blacklist.begin(); entry != key_image_blacklist.end();)
{
if (block_height >= entry->unlock_height)
entry = key_image_blacklist.erase(entry);
else
entry++;
}
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
//
// Expire Nodes
//
for (const crypto::public_key& pubkey : get_expired_nodes(db, nettype, block.major_version, block_height))
{
auto i = service_nodes_infos.find(pubkey);
if (i != service_nodes_infos.end())
{
if (my_pubkey && *my_pubkey == pubkey)
{
MGINFO_GREEN("Service node expired (yours): " << pubkey << " at block height: " << block_height);
}
else
{
LOG_PRINT_L1("Service node expired: " << pubkey << " at block height: " << block_height);
}
Use shared_ptr storage for service_node_info This converts the stored service_node_info value into a `shared_ptr<const service_node_info>` rather than a plain `service_node_info`. This yields a huge performance benefit by significantly eliminating the vast majority of service_node_info construction, destruction, and copying. Most of the time when we copy a service_node_info nothing in it has changed, which means we're storing exactly the same thing; this means an extra construction for every SN info on every block *and* an extra destruction when we cull old stored history. By using a shared_ptr, the vast majority of those constructions and destructions are eliminated. The immediately previous commit (upon which this one builds) already reduced a full rescan from 180s to 171s; this commit further reduces that time to 104s, or about 42% reduced from the rescan time required before this pair of commits. (All timings are from the dev.lokinet.org box, tested over multiple runs with the entire lmdb cached in memory). With the shared_ptr approach, we only make a copy when a change is actually needed: because of infrequent (at the per-SN level) events like a state_change, received reward, contribution, etc. The contained reference is deliberately `const` so that values are not changeable; there's a new function that does an explicit copying duplication, returning the new non-const and storing the const ref in the shared pointer. Related to this is a small change (and fix) to how proof info and public_ip/storage_port are stored: rather than store the values in the service_node_info struct itself, they now gets stored in a shared_ptr inside the service_node_info that intentionally gets shared among all copies of the service_node_info (that is, a SN info copy deliberately copies the pointer rather than the values). This also moves the ip/port values into the proof struct, since that seemed much easier than maintaining a separate shared_ptr for each value. Previously, because these were stored as values in the service_node_info they would actually get rolled back in the event of a reorg, but that seems highly undesirable: you would end up rolling back to the old values of the uptime proof and ip address (for example), but that should not happen: those values are not dependent on the blockchain and so should not be affected by a reorg/rollback. With this change they aren't since there is only one actual proof stored. Note that the shared storage here only applies to in-memory states; states loaded from the db will still be duplicated.
2019-08-11 18:19:24 +02:00
need_swarm_update += i->second->is_active();
service_nodes_infos.erase(i);
}
}
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
//
// Advance the list to the next candidate for a reward
//
2018-06-29 06:47:00 +02:00
{
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
crypto::public_key winner_pubkey = cryptonote::get_service_node_winner_from_tx_extra(block.miner_tx.extra);
auto it = service_nodes_infos.find(winner_pubkey);
if (it != service_nodes_infos.end())
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
// set the winner as though it was re-registering at transaction index=UINT32_MAX for this block
Use shared_ptr storage for service_node_info This converts the stored service_node_info value into a `shared_ptr<const service_node_info>` rather than a plain `service_node_info`. This yields a huge performance benefit by significantly eliminating the vast majority of service_node_info construction, destruction, and copying. Most of the time when we copy a service_node_info nothing in it has changed, which means we're storing exactly the same thing; this means an extra construction for every SN info on every block *and* an extra destruction when we cull old stored history. By using a shared_ptr, the vast majority of those constructions and destructions are eliminated. The immediately previous commit (upon which this one builds) already reduced a full rescan from 180s to 171s; this commit further reduces that time to 104s, or about 42% reduced from the rescan time required before this pair of commits. (All timings are from the dev.lokinet.org box, tested over multiple runs with the entire lmdb cached in memory). With the shared_ptr approach, we only make a copy when a change is actually needed: because of infrequent (at the per-SN level) events like a state_change, received reward, contribution, etc. The contained reference is deliberately `const` so that values are not changeable; there's a new function that does an explicit copying duplication, returning the new non-const and storing the const ref in the shared pointer. Related to this is a small change (and fix) to how proof info and public_ip/storage_port are stored: rather than store the values in the service_node_info struct itself, they now gets stored in a shared_ptr inside the service_node_info that intentionally gets shared among all copies of the service_node_info (that is, a SN info copy deliberately copies the pointer rather than the values). This also moves the ip/port values into the proof struct, since that seemed much easier than maintaining a separate shared_ptr for each value. Previously, because these were stored as values in the service_node_info they would actually get rolled back in the event of a reorg, but that seems highly undesirable: you would end up rolling back to the old values of the uptime proof and ip address (for example), but that should not happen: those values are not dependent on the blockchain and so should not be affected by a reorg/rollback. With this change they aren't since there is only one actual proof stored. Note that the shared storage here only applies to in-memory states; states loaded from the db will still be duplicated.
2019-08-11 18:19:24 +02:00
auto &info = duplicate_info(it->second);
info.last_reward_block_height = block_height;
info.last_reward_transaction_index = UINT32_MAX;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
2018-06-29 06:47:00 +02:00
}
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
//
// Process TXs in the Block
//
for (uint32_t index = 0; index < txs.size(); ++index)
2018-06-29 06:47:00 +02:00
{
Make tx type and version scoped enums This converts the transaction type and version to scoped enum, giving type safety and making the tx type assignment less error prone because there is no implicit conversion or comparison with raw integers that has to be worried about. This ends up converting any use of `cryptonote::transaction::type_xyz` to `cryptonote::transaction::txtype::xyz`. For version, names like `transaction::version_v4` become `cryptonote::txversion::v4_tx_types`. This also allows/includes various other simplifications related to or enabled by this change: - handle `is_deregister` dynamically in serialization code (setting `type::standard` or `type::deregister` rather than using a version-determined union) - `get_type()` is no longer needed with the above change: it is now much simpler to directly access `type` which will always have the correct value (even for v2 or v3 transaction types). And though there was an assertion on the enum value, `get_type()` was being used only sporadically: many places accessed `.type` directly. - the old unscoped enum didn't have a type but was assumed castable to/from `uint16_t`, which technically meant there was potential undefined behaviour when deserializing any type values >= 8. - tx type range checks weren't being done in all serialization paths; they are now. Because `get_type()` was not used everywhere (lots of places simply accessed `.type` directory) these might not have been caught. - `set_type()` is not needed; it was only being used in a single place (wallet2.cpp) and only for v4 txes, so the version protection code was never doing anything. - added a std::ostream << operator for the enum types so that they can be output with `<< tx_type <<` rather than needing to wrap it in `type_to_string(tx_type)` everywhere. For the versions, you get the annotated version string (e.g. 4_tx_types) rather than just the number 4.
2019-06-11 20:53:46 +02:00
const cryptonote::transaction& tx = txs[index];
if (tx.type == cryptonote::txtype::standard)
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
process_registration_tx(nettype, block, tx, index, my_pubkey);
need_swarm_update += process_contribution_tx(nettype, block, tx, index);
}
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
else if (tx.type == cryptonote::txtype::state_change)
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
need_swarm_update += process_state_change_tx(state_history, alt_states, nettype, block, tx, my_pubkey);
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
Make tx type and version scoped enums This converts the transaction type and version to scoped enum, giving type safety and making the tx type assignment less error prone because there is no implicit conversion or comparison with raw integers that has to be worried about. This ends up converting any use of `cryptonote::transaction::type_xyz` to `cryptonote::transaction::txtype::xyz`. For version, names like `transaction::version_v4` become `cryptonote::txversion::v4_tx_types`. This also allows/includes various other simplifications related to or enabled by this change: - handle `is_deregister` dynamically in serialization code (setting `type::standard` or `type::deregister` rather than using a version-determined union) - `get_type()` is no longer needed with the above change: it is now much simpler to directly access `type` which will always have the correct value (even for v2 or v3 transaction types). And though there was an assertion on the enum value, `get_type()` was being used only sporadically: many places accessed `.type` directly. - the old unscoped enum didn't have a type but was assumed castable to/from `uint16_t`, which technically meant there was potential undefined behaviour when deserializing any type values >= 8. - tx type range checks weren't being done in all serialization paths; they are now. Because `get_type()` was not used everywhere (lots of places simply accessed `.type` directory) these might not have been caught. - `set_type()` is not needed; it was only being used in a single place (wallet2.cpp) and only for v4 txes, so the version protection code was never doing anything. - added a std::ostream << operator for the enum types so that they can be output with `<< tx_type <<` rather than needing to wrap it in `type_to_string(tx_type)` everywhere. For the versions, you get the annotated version string (e.g. 4_tx_types) rather than just the number 4.
2019-06-11 20:53:46 +02:00
else if (tx.type == cryptonote::txtype::key_image_unlock)
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
process_key_image_unlock_tx(nettype, block_height, tx);
}
}
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
if (need_swarm_update)
{
crypto::hash const block_hash = cryptonote::get_block_hash(block);
uint64_t seed = 0;
std::memcpy(&seed, block_hash.data, sizeof(seed));
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
/// Gather existing swarms from infos
swarm_snode_map_t existing_swarms;
for (const auto &key_info : active_service_nodes_infos())
existing_swarms[key_info.second->swarm_id].push_back(key_info.first);
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
calc_swarm_changes(existing_swarms, seed);
/// Apply changes
for (const auto entry : existing_swarms) {
const swarm_id_t swarm_id = entry.first;
const std::vector<crypto::public_key>& snodes = entry.second;
for (const auto snode : snodes) {
auto& sn_info_ptr = service_nodes_infos.at(snode);
if (sn_info_ptr->swarm_id == swarm_id) continue; /// nothing changed for this snode
duplicate_info(sn_info_ptr).swarm_id = swarm_id;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
}
}
quorums = generate_quorums(nettype, hf_version, *this);
}
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
void service_node_list::process_block(const cryptonote::block& block, const std::vector<cryptonote::transaction>& txs)
{
uint64_t block_height = cryptonote::get_block_height(block);
uint8_t hf_version = m_blockchain.get_hard_fork_version(block_height);
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
if (hf_version < 9)
return;
//
// Cull old history
//
{
uint64_t cull_height = short_term_state_cull_height(hf_version, m_db, block_height);
auto end_it = m_state_history.upper_bound(cull_height);
for (auto it = m_state_history.begin(); it != end_it; it++)
{
if (m_store_quorum_history)
m_old_quorum_states.emplace_back(it->height, it->quorums);
uint64_t next_long_term_state = ((it->height / STORE_LONG_TERM_STATE_INTERVAL) + 1) * STORE_LONG_TERM_STATE_INTERVAL;
uint64_t dist_to_next_long_term_state = next_long_term_state - it->height;
bool need_quorum_for_future_states = (dist_to_next_long_term_state <= VOTE_LIFETIME + VOTE_OR_TX_VERIFY_HEIGHT_BUFFER);
if ((it->height % STORE_LONG_TERM_STATE_INTERVAL) == 0 || need_quorum_for_future_states)
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
m_state_added_to_archive = true;
if (need_quorum_for_future_states) // Preserve just quorum
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
state_t &state = const_cast<state_t &>(*it); // safe: set order only depends on state_t.height
state.service_nodes_infos = {};
state.key_image_blacklist = {};
state.only_loaded_quorums = true;
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
m_state_archive.emplace_hint(m_state_archive.end(), std::move(*it));
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
}
}
m_state_history.erase(m_state_history.begin(), end_it);
if (m_old_quorum_states.size() > m_store_quorum_history)
m_old_quorum_states.erase(m_old_quorum_states.begin(), m_old_quorum_states.begin() + (m_old_quorum_states.size() - m_store_quorum_history));
2018-06-29 06:47:00 +02:00
}
Service Node Deregister Part 5 (#89) * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * core, service_node_list: separated address from service node pubkey * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * Store service node lists for the duration of deregister lifetimes * Quorum min/max bug, sort node list, fix node to test list * Change quorum to store acc pub address, fix oob bug * Code review for expiring votes, acc keys to pub_key, improve err msgs * Add early out for is_deregistration_tx and protect against quorum changes * Remove debug code, fix segfault * Remove irrelevant check for tx v3 in blockchain, fix >= height for pruning quorum states Incorrect assumption that a transaction can be kept in the chain if it could eventually become invalid, because if it were the chain would be split and eventually these transaction would be dropped. But also that we should not override the pre-existing logic which handles this case anyway.
2018-07-18 04:42:47 +02:00
//
// Cull alt state history
//
if (hf_version >= cryptonote::network_version_12_checkpointing)
{
cryptonote::checkpoint_t immutable_checkpoint;
if (m_db->get_immutable_checkpoint(&immutable_checkpoint, block_height))
{
for (auto it = m_alt_state.begin(); it != m_alt_state.end(); )
{
state_t const &alt_state = it->second;
if (alt_state.height < immutable_checkpoint.height) it = m_alt_state.erase(it);
else it++;
}
}
}
cryptonote::network_type nettype = m_blockchain.nettype();
m_state_history.insert(m_state_history.end(), m_state);
m_state.update_from_block(*m_db, nettype, m_state_history, m_alt_state, block, txs, m_service_node_pubkey);
2018-06-29 06:47:00 +02:00
}
void service_node_list::blockchain_detached(uint64_t height)
{
std::lock_guard<boost::recursive_mutex> lock(m_sn_mutex);
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
uint64_t revert_to_height = height - 1;
bool reinitialise = false;
bool using_archive = false;
{
auto it = m_state_history.find(revert_to_height); // Try finding detached height directly
reinitialise = (it == m_state_history.end() || it->only_loaded_quorums);
if (!reinitialise)
m_state_history.erase(std::next(it), m_state_history.end());
}
// TODO(loki): We should loop through the prev 10k heights for robustness, but avoid for v4.0.5. Already enough changes going in
if (reinitialise) // Try finding the next closest old state at 10k intervals
{
uint64_t prev_interval = revert_to_height - (revert_to_height % STORE_LONG_TERM_STATE_INTERVAL);
auto it = m_state_archive.find(prev_interval);
reinitialise = (it == m_state_archive.end() || it->only_loaded_quorums);
if (!reinitialise)
{
m_state_history.clear();
m_state_archive.erase(std::next(it), m_state_archive.end());
using_archive = true;
}
}
if (reinitialise)
{
m_state_history.clear();
m_state_archive.clear();
init();
return;
2018-06-29 06:47:00 +02:00
}
Service Node Deregister Part 5 (#89) * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * core, service_node_list: separated address from service node pubkey * Retrieve quorum list from height, reviewed * Setup data structures for de/register TX * Submit and validate partial/full deregisters * Add P2P relaying of partial deregistration votes * Code review adjustments for deregistration part 1 - Fix check_tx_semantic - Remove signature_pod as votes are now stored as blobs. Serialization overrides don't intefere with crypto::signature anymore. * deregistration_vote_pool - changed sign/verify interface and removed repeated code * Misc review, fix sign/verify api, vote threshold * Deregister/tx edge case handling for combinatoric votes * Store service node lists for the duration of deregister lifetimes * Quorum min/max bug, sort node list, fix node to test list * Change quorum to store acc pub address, fix oob bug * Code review for expiring votes, acc keys to pub_key, improve err msgs * Add early out for is_deregistration_tx and protect against quorum changes * Remove debug code, fix segfault * Remove irrelevant check for tx v3 in blockchain, fix >= height for pruning quorum states Incorrect assumption that a transaction can be kept in the chain if it could eventually become invalid, because if it were the chain would be split and eventually these transaction would be dropped. But also that we should not override the pre-existing logic which handles this case anyway.
2018-07-18 04:42:47 +02:00
std::set<state_t> &history = (using_archive) ? m_state_archive : m_state_history;
auto it = std::prev(history.end());
m_state = std::move(*it);
history.erase(it);
if (m_state.height != revert_to_height)
rescan_starting_from_curr_state(false /*store_to_disk*/);
store();
2018-06-29 06:47:00 +02:00
}
std::vector<crypto::public_key> service_node_list::state_t::get_expired_nodes(cryptonote::BlockchainDB const &db,
cryptonote::network_type nettype,
uint8_t hf_version,
uint64_t block_height) const
2018-06-29 06:47:00 +02:00
{
std::vector<crypto::public_key> expired_nodes;
uint64_t const lock_blocks = staking_num_lock_blocks(nettype);
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
// TODO(loki): This should really use the registration height instead of getting the block and expiring nodes.
// But there's something subtly off when using registration height causing syncing problems.
if (hf_version == cryptonote::network_version_9_service_nodes)
2018-06-29 06:47:00 +02:00
{
if (block_height <= lock_blocks)
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
return expired_nodes;
2018-06-29 06:47:00 +02:00
const uint64_t expired_nodes_block_height = block_height - lock_blocks;
cryptonote::block block = {};
try
2018-06-29 06:47:00 +02:00
{
block = db.get_block_from_height(expired_nodes_block_height);
}
catch (std::exception const &e)
{
LOG_ERROR("Failed to get historical block to find expired nodes in v9: " << e.what());
return expired_nodes;
}
if (block.major_version < cryptonote::network_version_9_service_nodes)
return expired_nodes;
for (crypto::hash const &hash : block.tx_hashes)
{
cryptonote::transaction tx;
if (!db.get_tx(hash, tx))
{
LOG_ERROR("Failed to get historical tx to find expired service nodes in v9");
continue;
}
uint32_t index = 0;
crypto::public_key key;
service_node_info info = {};
if (is_registration_tx(nettype, cryptonote::network_version_9_service_nodes, tx, block.timestamp, expired_nodes_block_height, index, key, info))
expired_nodes.push_back(key);
index++;
2018-06-29 06:47:00 +02:00
}
2018-06-29 06:47:00 +02:00
}
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
else
{
for (auto it = service_nodes_infos.begin(); it != service_nodes_infos.end(); it++)
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
crypto::public_key const &snode_key = it->first;
Use shared_ptr storage for service_node_info This converts the stored service_node_info value into a `shared_ptr<const service_node_info>` rather than a plain `service_node_info`. This yields a huge performance benefit by significantly eliminating the vast majority of service_node_info construction, destruction, and copying. Most of the time when we copy a service_node_info nothing in it has changed, which means we're storing exactly the same thing; this means an extra construction for every SN info on every block *and* an extra destruction when we cull old stored history. By using a shared_ptr, the vast majority of those constructions and destructions are eliminated. The immediately previous commit (upon which this one builds) already reduced a full rescan from 180s to 171s; this commit further reduces that time to 104s, or about 42% reduced from the rescan time required before this pair of commits. (All timings are from the dev.lokinet.org box, tested over multiple runs with the entire lmdb cached in memory). With the shared_ptr approach, we only make a copy when a change is actually needed: because of infrequent (at the per-SN level) events like a state_change, received reward, contribution, etc. The contained reference is deliberately `const` so that values are not changeable; there's a new function that does an explicit copying duplication, returning the new non-const and storing the const ref in the shared pointer. Related to this is a small change (and fix) to how proof info and public_ip/storage_port are stored: rather than store the values in the service_node_info struct itself, they now gets stored in a shared_ptr inside the service_node_info that intentionally gets shared among all copies of the service_node_info (that is, a SN info copy deliberately copies the pointer rather than the values). This also moves the ip/port values into the proof struct, since that seemed much easier than maintaining a separate shared_ptr for each value. Previously, because these were stored as values in the service_node_info they would actually get rolled back in the event of a reorg, but that seems highly undesirable: you would end up rolling back to the old values of the uptime proof and ip address (for example), but that should not happen: those values are not dependent on the blockchain and so should not be affected by a reorg/rollback. With this change they aren't since there is only one actual proof stored. Note that the shared storage here only applies to in-memory states; states loaded from the db will still be duplicated.
2019-08-11 18:19:24 +02:00
const service_node_info &info = *it->second;
if (info.registration_hf_version >= cryptonote::network_version_11_infinite_staking)
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
{
if (info.requested_unlock_height != KEY_IMAGE_AWAITING_UNLOCK_HEIGHT && block_height > info.requested_unlock_height)
expired_nodes.push_back(snode_key);
}
else // Version 10 Bulletproofs
{
/// Note: this code exhibits a subtle unintended behaviour: a snode that
/// registered in hardfork 9 and was scheduled for deregistration in hardfork 10
/// will have its life is slightly prolonged by the "grace period", although it might
/// look like we use the registration height to determine the expiry height.
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
uint64_t node_expiry_height = info.registration_height + lock_blocks + STAKING_REQUIREMENT_LOCK_BLOCKS_EXCESS;
if (block_height > node_expiry_height)
expired_nodes.push_back(snode_key);
}
}
}
2018-06-29 06:47:00 +02:00
return expired_nodes;
}
block_winner service_node_list::state_t::get_block_winner() const
{
block_winner result = {};
service_node_info const *info = nullptr;
{
auto oldest_waiting = std::make_tuple(std::numeric_limits<uint64_t>::max(), std::numeric_limits<uint32_t>::max(), crypto::null_pkey);
for (const auto &info_it : service_nodes_infos)
{
const auto &sninfo = *info_it.second;
if (sninfo.is_active())
{
auto waiting_since = std::make_tuple(sninfo.last_reward_block_height, sninfo.last_reward_transaction_index, info_it.first);
if (waiting_since < oldest_waiting)
{
oldest_waiting = waiting_since;
info = &sninfo;
}
}
}
result.key = std::get<2>(oldest_waiting);
}
if (result.key == crypto::null_pkey)
{
result = service_nodes::null_block_winner;
return result;
}
2018-08-06 15:08:44 +02:00
// Add contributors and their portions to winners.
result.payouts.reserve(info->contributors.size());
const uint64_t remaining_portions = STAKING_PORTIONS - info->portions_for_operator;
for (const auto& contributor : info->contributors)
2018-08-06 15:08:44 +02:00
{
uint64_t hi, lo, resulthi, resultlo;
lo = mul128(contributor.amount, remaining_portions, &hi);
div128_64(hi, lo, info->staking_requirement, &resulthi, &resultlo);
if (contributor.address == info->operator_address)
resultlo += info->portions_for_operator;
result.payouts.push_back({contributor.address, resultlo});
}
return result;
2018-06-29 06:47:00 +02:00
}
bool service_node_list::validate_miner_tx(const crypto::hash& prev_id, const cryptonote::transaction& miner_tx, uint64_t height, int hf_version, cryptonote::block_reward_parts const &reward_parts) const
2018-06-29 06:47:00 +02:00
{
std::lock_guard<boost::recursive_mutex> lock(m_sn_mutex);
if (hf_version < 9)
2018-06-29 06:47:00 +02:00
return true;
// NOTE(loki): Service node reward distribution is calculated from the
// original amount, i.e. 50% of the original base reward goes to service
// nodes not 50% of the reward after removing the governance component (the
// adjusted base reward post hardfork 10).
uint64_t base_reward = reward_parts.original_base_reward;
uint64_t total_service_node_reward = cryptonote::service_node_reward_formula(base_reward, hf_version);
2018-06-29 06:47:00 +02:00
block_winner winner = m_state.get_block_winner();
crypto::public_key check_winner_pubkey = cryptonote::get_service_node_winner_from_tx_extra(miner_tx.extra);
if (winner.key != check_winner_pubkey)
{
MERROR("Service node reward winner is incorrect! Expected " << winner.key << ", block has " << check_winner_pubkey);
2018-06-29 06:47:00 +02:00
return false;
}
2018-06-29 06:47:00 +02:00
if ((miner_tx.vout.size() - 1) < winner.payouts.size())
{
MERROR("Service node reward specifies more winners than available outputs: " << (miner_tx.vout.size() - 1) << ", winners: " << winner.payouts.size());
2018-06-29 06:47:00 +02:00
return false;
}
2018-06-29 06:47:00 +02:00
for (size_t i = 0; i < winner.payouts.size(); i++)
2018-06-29 06:47:00 +02:00
{
size_t vout_index = i + 1;
payout_entry const &payout = winner.payouts[i];
uint64_t reward = cryptonote::get_portion_of_reward(payout.portions, total_service_node_reward);
2018-06-29 06:47:00 +02:00
if (miner_tx.vout[vout_index].amount != reward)
{
MERROR("Service node reward amount incorrect. Should be " << cryptonote::print_money(reward) << ", is: " << cryptonote::print_money(miner_tx.vout[vout_index].amount));
return false;
}
2018-06-29 06:47:00 +02:00
if (miner_tx.vout[vout_index].target.type() != typeid(cryptonote::txout_to_key))
{
MERROR("Service node output target type should be txout_to_key");
return false;
}
crypto::key_derivation derivation = AUTO_VAL_INIT(derivation);
crypto::public_key out_eph_public_key = AUTO_VAL_INIT(out_eph_public_key);
cryptonote::keypair gov_key = cryptonote::get_deterministic_keypair_from_height(height);
bool r = crypto::generate_key_derivation(payout.address.m_view_public_key, gov_key.sec, derivation);
CHECK_AND_ASSERT_MES(r, false, "while creating outs: failed to generate_key_derivation(" << payout.address.m_view_public_key << ", " << gov_key.sec << ")");
r = crypto::derive_public_key(derivation, vout_index, payout.address.m_spend_public_key, out_eph_public_key);
CHECK_AND_ASSERT_MES(r, false, "while creating outs: failed to derive_public_key(" << derivation << ", " << vout_index << ", "<< payout.address.m_spend_public_key << ")");
if (boost::get<cryptonote::txout_to_key>(miner_tx.vout[vout_index].target).key != out_eph_public_key)
{
MERROR("Invalid service node reward output");
return false;
}
2018-06-29 06:47:00 +02:00
}
return true;
}
bool service_node_list::alt_block_added(cryptonote::block const &block, std::vector<cryptonote::transaction> const &txs, cryptonote::checkpoint_t const *checkpoint)
{
if (block.major_version < cryptonote::network_version_9_service_nodes)
return true;
uint64_t block_height = cryptonote::get_block_height(block);
state_t const *starting_state = nullptr;
crypto::hash const block_hash = get_block_hash(block);
auto it = m_alt_state.find(block_hash);
if (it != m_alt_state.end()) return true; // NOTE: Already processed alt-state for this block
// NOTE: Check if alt block forks off some historical state on the canonical chain
if (!starting_state)
{
auto it = m_state_history.find(block_height - 1);
if (it != m_state_history.end())
if (block.prev_id == it->block_hash) starting_state = &(*it);
}
// NOTE: Check if alt block forks off some historical alt state on an alt chain
if (!starting_state)
{
auto it = m_alt_state.find(block.prev_id);
if (it != m_alt_state.end()) starting_state = &it->second;
}
if (!starting_state)
{
LOG_PRINT_L1("Received alt block but couldn't find parent state in historical state");
return false;
}
if (starting_state->block_hash != block.prev_id)
{
LOG_PRINT_L1("Unexpected state_t's hash: " << starting_state->block_hash
<< ", does not match the block prev hash: " << block.prev_id);
return false;
}
state_t alt_state = *starting_state;
alt_state.update_from_block(*m_db, m_blockchain.nettype(), m_state_history, m_alt_state, block, txs, m_service_node_pubkey);
m_alt_state[block_hash] = std::move(alt_state);
if (checkpoint)
{
std::vector<std::shared_ptr<const service_nodes::testing_quorum>> alt_quorums;
std::shared_ptr<const testing_quorum> quorum = get_testing_quorum(quorum_type::checkpointing, checkpoint->height, false, &alt_quorums);
if (!quorum)
return false;
if (!service_nodes::verify_checkpoint(block.major_version, *checkpoint, *quorum))
{
bool verified_on_alt_quorum = false;
for (std::shared_ptr<const service_nodes::testing_quorum> alt_quorum : alt_quorums)
{
if (service_nodes::verify_checkpoint(block.major_version, *checkpoint, *alt_quorum))
{
verified_on_alt_quorum = true;
break;
}
}
if (!verified_on_alt_quorum)
return false;
}
}
return true;
}
2018-06-29 06:47:00 +02:00
//////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
static service_node_list::quorum_for_serialization serialize_quorum_state(uint8_t hf_version, uint64_t height, quorum_manager const &quorums)
{
service_node_list::quorum_for_serialization result = {};
result.height = height;
if (quorums.obligations) result.quorums[static_cast<uint8_t>(quorum_type::obligations)] = *quorums.obligations;
if (quorums.checkpointing) result.quorums[static_cast<uint8_t>(quorum_type::checkpointing)] = *quorums.checkpointing;
return result;
}
static service_node_list::state_serialized serialize_service_node_state_object(uint8_t hf_version, service_node_list::state_t const &state, bool only_serialize_quorums = false)
{
service_node_list::state_serialized result = {};
result.version = service_node_list::state_serialized::get_version(hf_version);
result.height = state.height;
result.quorums = serialize_quorum_state(hf_version, state.height, state.quorums);
result.only_stored_quorums = state.only_loaded_quorums || only_serialize_quorums;
if (only_serialize_quorums)
return result;
result.infos.reserve(state.service_nodes_infos.size());
for (const auto &kv_pair : state.service_nodes_infos)
result.infos.emplace_back(kv_pair);
result.key_image_blacklist = state.key_image_blacklist;
result.block_hash = state.block_hash;
return result;
}
bool service_node_list::store()
{
if (!m_db)
return false; // Haven't been initialized yet
uint8_t hf_version = m_blockchain.get_current_hard_fork_version();
if (hf_version < cryptonote::network_version_9_service_nodes)
Infinite Staking Part 1 (#387) * Remove dead branches in hot-path check_tx_inputs Also renames #define for mixins to better match naming convention * Shuffle around some more code into common branches * Fix min/max tx version rules, since there 1 tx v2 on v9 fork * First draft infinite staking implementation * Actually generate the right key image and expire appropriately * Add framework to lock key images after expiry * Return locked key images for nodes, add request unlock option * Introduce transaction types for key image unlock * Update validation steps to accept tx types, key_image_unlock * Add mapping for lockable key images to amounts * Change inconsistent naming scheme of contributors * Create key image unlock transaction type and process it * Update tx params to allow v4 types and as a result construct_tx* * Fix some serialisation issues not sending all the information * Fix dupe tx extra tag causing incorrect deserialisation * Add warning comments * Fix key image unlocks parsing error * Simplify key image proof checks * Fix rebase errors * Correctly calculate the key image unlock times * Blacklist key image on deregistration * Serialise key image blacklist * Rollback blacklisted key images * Fix expiry logic error * Disallow requesting stake unlock if already unlocked client side * Add double spend checks for key image unlocks * Rename get_staking_requirement_lock_blocks To staking_initial_num_lock_blocks * Begin modifying output selection to not use locked outputs * Modify output selection to avoid locked/blacklisted key images * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add additional test, fix assert * Remove debug code in wallet * Fix merge dev problem
2019-01-25 04:15:52 +01:00
return true;
data_for_serialization *data[] = {&m_cache_long_term_data, &m_cache_short_term_data};
auto const serialize_version = data_for_serialization::get_version(hf_version);
std::lock_guard<boost::recursive_mutex> lock(m_sn_mutex);
for (data_for_serialization *serialize_entry : data)
{
if (serialize_entry->version != serialize_version) m_state_added_to_archive = true;
serialize_entry->version = serialize_version;
serialize_entry->clear();
}
m_cache_short_term_data.quorum_states.reserve(m_old_quorum_states.size());
for (const quorums_by_height &entry : m_old_quorum_states)
m_cache_short_term_data.quorum_states.push_back(serialize_quorum_state(hf_version, entry.height, entry.quorums));
2019-08-13 05:05:21 +02:00
if (m_state_added_to_archive)
{
for (auto const &it : m_state_archive)
m_cache_long_term_data.states.push_back(serialize_service_node_state_object(hf_version, it));
}
// NOTE: A state_t may reference quorums up to (VOTE_LIFETIME
// + VOTE_OR_TX_VERIFY_HEIGHT_BUFFER) blocks back. So in the
// (MAX_SHORT_TERM_STATE_HISTORY | 2nd oldest checkpoint) window of states we store, the
// first (VOTE_LIFETIME + VOTE_OR_TX_VERIFY_HEIGHT_BUFFER) states we only
// store their quorums, such that the following states have quorum
// information preceeding it.
uint64_t const max_short_term_height = short_term_state_cull_height(hf_version, m_db, (m_state.height - 1)) + VOTE_LIFETIME + VOTE_OR_TX_VERIFY_HEIGHT_BUFFER;
for (auto it = m_state_history.begin();
it != m_state_history.end() && it->height <= max_short_term_height;
it++)
{
// TODO(loki): There are 2 places where we convert a state_t to be a serialized state_t without quorums. We should only do this in one location for clarity.
m_cache_short_term_data.states.push_back(serialize_service_node_state_object(hf_version, *it, it->height < max_short_term_height /*only_serialize_quorums*/));
}
m_cache_data_blob.clear();
if (m_state_added_to_archive)
{
std::stringstream ss;
binary_archive<true> ba(ss);
bool r = ::serialization::serialize(ba, m_cache_long_term_data);
CHECK_AND_ASSERT_MES(r, false, "Failed to store service node info: failed to serialize long term data");
m_cache_data_blob.append(ss.str());
{
cryptonote::db_wtxn_guard txn_guard(m_db);
m_db->set_service_node_data(m_cache_data_blob, true /*long_term*/);
}
}
m_cache_data_blob.clear();
{
std::stringstream ss;
binary_archive<true> ba(ss);
bool r = ::serialization::serialize(ba, m_cache_short_term_data);
CHECK_AND_ASSERT_MES(r, false, "Failed to store service node info: failed to serialize short term data data");
m_cache_data_blob.append(ss.str());
{
cryptonote::db_wtxn_guard txn_guard(m_db);
m_db->set_service_node_data(m_cache_data_blob, false /*long_term*/);
}
}
m_state_added_to_archive = false;
return true;
}
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
void service_node_list::get_all_service_nodes_public_keys(std::vector<crypto::public_key>& keys, bool require_active) const
{
keys.clear();
keys.reserve(m_state.service_nodes_infos.size());
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
if (require_active) {
for (const auto &key_info : m_state.service_nodes_infos)
Use shared_ptr storage for service_node_info This converts the stored service_node_info value into a `shared_ptr<const service_node_info>` rather than a plain `service_node_info`. This yields a huge performance benefit by significantly eliminating the vast majority of service_node_info construction, destruction, and copying. Most of the time when we copy a service_node_info nothing in it has changed, which means we're storing exactly the same thing; this means an extra construction for every SN info on every block *and* an extra destruction when we cull old stored history. By using a shared_ptr, the vast majority of those constructions and destructions are eliminated. The immediately previous commit (upon which this one builds) already reduced a full rescan from 180s to 171s; this commit further reduces that time to 104s, or about 42% reduced from the rescan time required before this pair of commits. (All timings are from the dev.lokinet.org box, tested over multiple runs with the entire lmdb cached in memory). With the shared_ptr approach, we only make a copy when a change is actually needed: because of infrequent (at the per-SN level) events like a state_change, received reward, contribution, etc. The contained reference is deliberately `const` so that values are not changeable; there's a new function that does an explicit copying duplication, returning the new non-const and storing the const ref in the shared pointer. Related to this is a small change (and fix) to how proof info and public_ip/storage_port are stored: rather than store the values in the service_node_info struct itself, they now gets stored in a shared_ptr inside the service_node_info that intentionally gets shared among all copies of the service_node_info (that is, a SN info copy deliberately copies the pointer rather than the values). This also moves the ip/port values into the proof struct, since that seemed much easier than maintaining a separate shared_ptr for each value. Previously, because these were stored as values in the service_node_info they would actually get rolled back in the event of a reorg, but that seems highly undesirable: you would end up rolling back to the old values of the uptime proof and ip address (for example), but that should not happen: those values are not dependent on the blockchain and so should not be affected by a reorg/rollback. With this change they aren't since there is only one actual proof stored. Note that the shared storage here only applies to in-memory states; states loaded from the db will still be duplicated.
2019-08-11 18:19:24 +02:00
if (key_info.second->is_active())
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
keys.push_back(key_info.first);
}
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
else {
for (const auto &key_info : m_state.service_nodes_infos)
Relax deregistration rules The replaces the deregistration mechanism with a new state change mechanism (beginning at the v12 fork) which can change a service node's network status via three potential values (and is extensible in the future to handle more): - deregistered -- this is the same as the existing deregistration; the SN is instantly removed from the SN list. - decommissioned -- this is a sort of temporary deregistration: your SN remains in the service node list, but is removed from the rewards list and from any network duties. - recommissioned -- this tx is sent by a quorum if they observe a decommissioned SN sending uptime proofs again. Upon reception, the SN is reactivated and put on the end of the reward list. Since this is broadening the quorum use, this also renames the relevant quorum to a "obligations" quorum (since it validates SN obligations), while the transactions are "state_change" transactions (since they change the state of a registered SN). The new parameters added to service_node_rules.h control how this works: // Service node decommissioning: as service nodes stay up they earn "credits" (measured in blocks) // towards a future outage. A new service node starts out with INITIAL_CREDIT, and then builds up // CREDIT_PER_DAY for each day the service node remains active up to a maximum of // DECOMMISSION_MAX_CREDIT. // // If a service node stops sending uptime proofs, a quorum will consider whether the service node // has built up enough credits (at least MINIMUM): if so, instead of submitting a deregistration, // it instead submits a decommission. This removes the service node from the list of active // service nodes both for rewards and for any active network duties. If the service node comes // back online (i.e. starts sending the required performance proofs again) before the credits run // out then a quorum will reinstate the service node using a recommission transaction, which adds // the service node back to the bottom of the service node reward list, and resets its accumulated // credits to 0. If it does not come back online within the required number of blocks (i.e. the // accumulated credit at the point of decommissioning) then a quorum will send a permanent // deregistration transaction to the network, starting a 30-day deregistration count down. This commit currently includes values (which are not necessarily finalized): - 8 hours (240 blocks) of credit required for activation of a decommission (rather than a deregister) - 0 initial credits at registration - a maximum of 24 hours (720 blocks) of credits - credits accumulate at a rate that you hit 24 hours of credits after 30 days of operation. Miscellaneous other details of this PR: - a new TX extra tag is used for the state change (including deregistrations). The old extra tag has no version or type tag, so couldn't be reused. The data in the new tag is slightly more efficiently packed than the old deregistration transaction, so it gets used for deregistrations (starting at the v12 fork) as well. - Correct validator/worker selection required generalizing the shuffle function to be able to shuffle just part of a vector. This lets us stick any down service nodes at the end of the potential list, then select validators by only shuffling the part of the index vector that contains active service indices. Once the validators are selected, the remainder of the list (this time including decommissioned SN indices) is shuffled to select quorum workers to check, thus allowing decommisioned nodes to be randomly included in the nodes to check without being selected as a validator. - Swarm recalculation was not quite right: swarms were recalculated on SN registrations, even if those registrations were include shared node registrations, but *not* recalculated on stakes. Starting with the upgrade this behaviour is fixed (swarms aren't actually used currently and aren't consensus-relevant so recalculating early won't hurt anything). - Details on decomm/dereg are added to RPC info and print_sn/print_sn_status - Slightly improves the % of reward output in the print_sn output by rounding it to two digits, and reserves space in the output string to avoid excessive reallocations. - Adds various debugging at higher debug levels to quorum voting (into all of voting itself, vote transmission, and vote reception). - Reset service node list internal data structure version to 0. The SN list has to be rescanned anyway at upgrade (its size has changed), so we might as well reset the version and remove the version-dependent serialization code. (Note that the affected code here is for SN states in lmdb storage, not for SN-to-SN communication serialization).
2019-06-18 23:57:02 +02:00
keys.push_back(key_info.first);
}
}
static crypto::hash make_uptime_proof_hash(crypto::public_key const &pubkey, uint64_t timestamp, uint32_t pub_ip, uint16_t storage_port)
{
constexpr size_t BUFFER_SIZE = sizeof(pubkey) + sizeof(timestamp) + sizeof(pub_ip) + sizeof(storage_port);
boost::endian::native_to_little_inplace(timestamp);
boost::endian::native_to_little_inplace(pub_ip);
boost::endian::native_to_little_inplace(storage_port);
char buf[BUFFER_SIZE];
crypto::hash result;
memcpy(buf, reinterpret_cast<const void *>(&pubkey), sizeof(pubkey));
memcpy(buf + sizeof(pubkey), reinterpret_cast<const void *>(&timestamp), sizeof(timestamp));
memcpy(buf + sizeof(pubkey) + sizeof(timestamp), reinterpret_cast<const void *>(&pub_ip), sizeof(pub_ip));
memcpy(buf + sizeof(pubkey) + sizeof(timestamp) + sizeof(pub_ip), reinterpret_cast<const void *>(&storage_port), sizeof(storage_port));
crypto::cn_fast_hash(buf, sizeof(buf), result);
return result;
}
cryptonote::NOTIFY_UPTIME_PROOF::request service_node_list::generate_uptime_proof(crypto::public_key const &pubkey,
crypto::secret_key const &key,
uint32_t public_ip,
uint16_t storage_port) const
{
cryptonote::NOTIFY_UPTIME_PROOF::request result = {};
result.snode_version_major = static_cast<uint16_t>(LOKI_VERSION_MAJOR);
result.snode_version_minor = static_cast<uint16_t>(LOKI_VERSION_MINOR);
result.snode_version_patch = static_cast<uint16_t>(LOKI_VERSION_PATCH);
result.timestamp = time(nullptr);
result.pubkey = pubkey;
result.public_ip = public_ip;
result.storage_port = storage_port;
crypto::hash hash = make_uptime_proof_hash(pubkey, result.timestamp, public_ip, storage_port);
crypto::generate_signature(hash, pubkey, key, result.sig);
return result;
}
bool service_node_list::handle_uptime_proof(cryptonote::NOTIFY_UPTIME_PROOF::request const &proof, bool &my_uptime_proof_confirmation)
{
uint8_t const hf_version = m_blockchain.get_current_hard_fork_version();
uint64_t const now = time(nullptr);
// NOTE: Validate proof version, timestamp range,
{
if ((proof.timestamp < now - UPTIME_PROOF_BUFFER_IN_SECONDS) || (proof.timestamp > now + UPTIME_PROOF_BUFFER_IN_SECONDS))
{
LOG_PRINT_L2("Rejecting uptime proof from " << proof.pubkey << ": timestamp is too far from now");
return false;
}
// NOTE: Only care about major version for now
if (hf_version >= cryptonote::network_version_13_enforce_checkpoints && proof.snode_version_major < 5)
{
LOG_PRINT_L2("Rejecting uptime proof from " << proof.pubkey
<< ": v5+ loki version is required for v13+ network proofs");
return false;
}
if (hf_version >= cryptonote::network_version_12_checkpointing && proof.snode_version_major < 4)
{
LOG_PRINT_L2("Rejecting uptime proof from " << proof.pubkey
<< ": v4+ loki version is required for v12+ network proofs");
return false;
}
else if (hf_version >= cryptonote::network_version_11_infinite_staking && proof.snode_version_major < 3)
{
LOG_PRINT_L2("Rejecting uptime proof from " << proof.pubkey << ": v3+ loki version is required for v11+ network proofs");
return false;
}
else if (hf_version >= cryptonote::network_version_10_bulletproofs && proof.snode_version_major < 2)
{
LOG_PRINT_L2("Rejecting uptime proof from " << proof.pubkey << ": v2+ loki version is required for v10+ network proofs");
return false;
}
}
//
// NOTE: Validate proof signature
//
{
crypto::hash hash = make_uptime_proof_hash(proof.pubkey, proof.timestamp, proof.public_ip, proof.storage_port);
bool signature_ok = crypto::check_signature(hash, proof.pubkey, proof.sig);
if (epee::net_utils::is_ip_local(proof.public_ip) || epee::net_utils::is_ip_loopback(proof.public_ip)) return false; // Sanity check; we do the same on lokid startup
if (!signature_ok)
{
LOG_PRINT_L2("Rejecting uptime proof from " << proof.pubkey << ": signature validation failed");
return false;
}
}
std::lock_guard<boost::recursive_mutex> lock(m_sn_mutex);
auto it = m_state.service_nodes_infos.find(proof.pubkey);
if (it == m_state.service_nodes_infos.end())
{
LOG_PRINT_L2("Rejecting uptime proof from " << proof.pubkey << ": no such service node is currently registered");
return false;
}
Use shared_ptr storage for service_node_info This converts the stored service_node_info value into a `shared_ptr<const service_node_info>` rather than a plain `service_node_info`. This yields a huge performance benefit by significantly eliminating the vast majority of service_node_info construction, destruction, and copying. Most of the time when we copy a service_node_info nothing in it has changed, which means we're storing exactly the same thing; this means an extra construction for every SN info on every block *and* an extra destruction when we cull old stored history. By using a shared_ptr, the vast majority of those constructions and destructions are eliminated. The immediately previous commit (upon which this one builds) already reduced a full rescan from 180s to 171s; this commit further reduces that time to 104s, or about 42% reduced from the rescan time required before this pair of commits. (All timings are from the dev.lokinet.org box, tested over multiple runs with the entire lmdb cached in memory). With the shared_ptr approach, we only make a copy when a change is actually needed: because of infrequent (at the per-SN level) events like a state_change, received reward, contribution, etc. The contained reference is deliberately `const` so that values are not changeable; there's a new function that does an explicit copying duplication, returning the new non-const and storing the const ref in the shared pointer. Related to this is a small change (and fix) to how proof info and public_ip/storage_port are stored: rather than store the values in the service_node_info struct itself, they now gets stored in a shared_ptr inside the service_node_info that intentionally gets shared among all copies of the service_node_info (that is, a SN info copy deliberately copies the pointer rather than the values). This also moves the ip/port values into the proof struct, since that seemed much easier than maintaining a separate shared_ptr for each value. Previously, because these were stored as values in the service_node_info they would actually get rolled back in the event of a reorg, but that seems highly undesirable: you would end up rolling back to the old values of the uptime proof and ip address (for example), but that should not happen: those values are not dependent on the blockchain and so should not be affected by a reorg/rollback. With this change they aren't since there is only one actual proof stored. Note that the shared storage here only applies to in-memory states; states loaded from the db will still be duplicated.
2019-08-11 18:19:24 +02:00
const service_node_info &info = *it->second;
if (info.proof->timestamp >= now - (UPTIME_PROOF_FREQUENCY_IN_SECONDS / 2))
{
LOG_PRINT_L2("Rejecting uptime proof from " << proof.pubkey
<< ": already received one uptime proof for this node recently");
return false;
}
if (m_service_node_pubkey && (proof.pubkey == *m_service_node_pubkey))
{
my_uptime_proof_confirmation = true;
MGINFO("Received uptime-proof confirmation back from network for Service Node (yours): " << proof.pubkey);
}
else
{
my_uptime_proof_confirmation = false;
LOG_PRINT_L2("Accepted uptime proof from " << proof.pubkey);
}
Use shared_ptr storage for service_node_info This converts the stored service_node_info value into a `shared_ptr<const service_node_info>` rather than a plain `service_node_info`. This yields a huge performance benefit by significantly eliminating the vast majority of service_node_info construction, destruction, and copying. Most of the time when we copy a service_node_info nothing in it has changed, which means we're storing exactly the same thing; this means an extra construction for every SN info on every block *and* an extra destruction when we cull old stored history. By using a shared_ptr, the vast majority of those constructions and destructions are eliminated. The immediately previous commit (upon which this one builds) already reduced a full rescan from 180s to 171s; this commit further reduces that time to 104s, or about 42% reduced from the rescan time required before this pair of commits. (All timings are from the dev.lokinet.org box, tested over multiple runs with the entire lmdb cached in memory). With the shared_ptr approach, we only make a copy when a change is actually needed: because of infrequent (at the per-SN level) events like a state_change, received reward, contribution, etc. The contained reference is deliberately `const` so that values are not changeable; there's a new function that does an explicit copying duplication, returning the new non-const and storing the const ref in the shared pointer. Related to this is a small change (and fix) to how proof info and public_ip/storage_port are stored: rather than store the values in the service_node_info struct itself, they now gets stored in a shared_ptr inside the service_node_info that intentionally gets shared among all copies of the service_node_info (that is, a SN info copy deliberately copies the pointer rather than the values). This also moves the ip/port values into the proof struct, since that seemed much easier than maintaining a separate shared_ptr for each value. Previously, because these were stored as values in the service_node_info they would actually get rolled back in the event of a reorg, but that seems highly undesirable: you would end up rolling back to the old values of the uptime proof and ip address (for example), but that should not happen: those values are not dependent on the blockchain and so should not be affected by a reorg/rollback. With this change they aren't since there is only one actual proof stored. Note that the shared storage here only applies to in-memory states; states loaded from the db will still be duplicated.
2019-08-11 18:19:24 +02:00
auto &iproof = *info.proof;
Fix 4.0.4 uptime proof transmission after recomm When a node gets recommissioned in 4.0.4 we reset its timestamp to the current time to delay obligations checks for newly recommissioned nodes, but this reset caused problems: - the code runs not only when a fresh block is received, but also when syncing or rescanning, and so time(NULL) gets used to update the node's timestamp even if it is an old record, and since proof info is shared across states, the affects the current state. - as a result of the above, a just-rescanned node that has been decommissioned at some point in the past will think it has just sent a proof, and so won't send any proofs for an hour. - A just-rescanned node won't accept or relay any proofs for any node that was recommissioned in its scan for the first half an hour, but this lack of relaying can cause chaos in getting uptime proofs out across the network, especially while we still have 4.0.3 nodes that need it. To address the first issue, this switches the recommissioning to use the block timestamp rather than the current timestamp. This *will* be slightly delayed in the case of current blocks (since a block timestamp is the time the pool *started* working on the block, which is generally the time the previous block was found on the network), but even with an exceptionally long block delay (e.g. 20 minutes) we are still fending off obligations checks for 1h40m. That would partially fix issues 2 and 3, but we actually don't want a recommissioning to look like a received uptime proof for a couple reasons: - When we haven't actually received an uptime proof it's confusing to report that we have (at the recommission time) and may mask an underlying issue of a node that isn't actually sending proofs for some reason (which might be more common for a node that has just been decommissioned/recommissioned). There's also a related weird state here for nodes that have come on recently: they think the SN is active, but have 0's for IP and storage server port. - 4.0.3 nodes don't get the updated timestamp and so really need the proof to come through even when the 4.0.4 nodes don't think it's important/acceptable. So to also fix these, this commits adds an "effective_timestamp" to the proof info: if it is larger than the actual timestamp field, we use it instead of the actual one for obligations checking. On a recommission, we update only the effective field so that we can delay obligations checking for a couple of hours without delaying actual proofs info going over the network.
2019-08-16 19:31:58 +02:00
iproof.update_timestamp(now);
Use shared_ptr storage for service_node_info This converts the stored service_node_info value into a `shared_ptr<const service_node_info>` rather than a plain `service_node_info`. This yields a huge performance benefit by significantly eliminating the vast majority of service_node_info construction, destruction, and copying. Most of the time when we copy a service_node_info nothing in it has changed, which means we're storing exactly the same thing; this means an extra construction for every SN info on every block *and* an extra destruction when we cull old stored history. By using a shared_ptr, the vast majority of those constructions and destructions are eliminated. The immediately previous commit (upon which this one builds) already reduced a full rescan from 180s to 171s; this commit further reduces that time to 104s, or about 42% reduced from the rescan time required before this pair of commits. (All timings are from the dev.lokinet.org box, tested over multiple runs with the entire lmdb cached in memory). With the shared_ptr approach, we only make a copy when a change is actually needed: because of infrequent (at the per-SN level) events like a state_change, received reward, contribution, etc. The contained reference is deliberately `const` so that values are not changeable; there's a new function that does an explicit copying duplication, returning the new non-const and storing the const ref in the shared pointer. Related to this is a small change (and fix) to how proof info and public_ip/storage_port are stored: rather than store the values in the service_node_info struct itself, they now gets stored in a shared_ptr inside the service_node_info that intentionally gets shared among all copies of the service_node_info (that is, a SN info copy deliberately copies the pointer rather than the values). This also moves the ip/port values into the proof struct, since that seemed much easier than maintaining a separate shared_ptr for each value. Previously, because these were stored as values in the service_node_info they would actually get rolled back in the event of a reorg, but that seems highly undesirable: you would end up rolling back to the old values of the uptime proof and ip address (for example), but that should not happen: those values are not dependent on the blockchain and so should not be affected by a reorg/rollback. With this change they aren't since there is only one actual proof stored. Note that the shared storage here only applies to in-memory states; states loaded from the db will still be duplicated.
2019-08-11 18:19:24 +02:00
iproof.version_major = proof.snode_version_major;
iproof.version_minor = proof.snode_version_minor;
iproof.version_patch = proof.snode_version_patch;
iproof.public_ip = proof.public_ip;
iproof.storage_port = proof.storage_port;
// Track any IP changes (so that the obligations quorum can penalize for IP changes)
// First prune any stale (>1w) ip info. 1 week is probably excessive, but IP switches should be
// rare and this could, in theory, be useful for diagnostics.
Use shared_ptr storage for service_node_info This converts the stored service_node_info value into a `shared_ptr<const service_node_info>` rather than a plain `service_node_info`. This yields a huge performance benefit by significantly eliminating the vast majority of service_node_info construction, destruction, and copying. Most of the time when we copy a service_node_info nothing in it has changed, which means we're storing exactly the same thing; this means an extra construction for every SN info on every block *and* an extra destruction when we cull old stored history. By using a shared_ptr, the vast majority of those constructions and destructions are eliminated. The immediately previous commit (upon which this one builds) already reduced a full rescan from 180s to 171s; this commit further reduces that time to 104s, or about 42% reduced from the rescan time required before this pair of commits. (All timings are from the dev.lokinet.org box, tested over multiple runs with the entire lmdb cached in memory). With the shared_ptr approach, we only make a copy when a change is actually needed: because of infrequent (at the per-SN level) events like a state_change, received reward, contribution, etc. The contained reference is deliberately `const` so that values are not changeable; there's a new function that does an explicit copying duplication, returning the new non-const and storing the const ref in the shared pointer. Related to this is a small change (and fix) to how proof info and public_ip/storage_port are stored: rather than store the values in the service_node_info struct itself, they now gets stored in a shared_ptr inside the service_node_info that intentionally gets shared among all copies of the service_node_info (that is, a SN info copy deliberately copies the pointer rather than the values). This also moves the ip/port values into the proof struct, since that seemed much easier than maintaining a separate shared_ptr for each value. Previously, because these were stored as values in the service_node_info they would actually get rolled back in the event of a reorg, but that seems highly undesirable: you would end up rolling back to the old values of the uptime proof and ip address (for example), but that should not happen: those values are not dependent on the blockchain and so should not be affected by a reorg/rollback. With this change they aren't since there is only one actual proof stored. Note that the shared storage here only applies to in-memory states; states loaded from the db will still be duplicated.
2019-08-11 18:19:24 +02:00
auto &ips = info.proof->public_ips;
// If we already know about the IP, update its timestamp:
if (ips[0].first && ips[0].first == proof.public_ip)
ips[0].second = now;
else if (ips[1].first && ips[1].first == proof.public_ip)
ips[1].second = now;
// Otherwise replace whichever IP has the older timestamp
else if (ips[0].second > ips[1].second)
ips[1] = {proof.public_ip, now};
else
ips[0] = {proof.public_ip, now};
return true;
}
void service_node_list::record_checkpoint_vote(crypto::public_key const &pubkey, uint64_t height, bool voted)
{
std::lock_guard<boost::recursive_mutex> lock(m_sn_mutex);
auto it = m_state.service_nodes_infos.find(pubkey);
if (it == m_state.service_nodes_infos.end())
return;
proof_info &info = *it->second->proof;
info.votes[info.vote_index].height = height;
info.votes[info.vote_index].voted = voted;
info.vote_index = (info.vote_index + 1) % info.votes.size();
}
bool service_node_list::set_storage_server_peer_reachable(crypto::public_key const &pubkey, bool value)
{
std::lock_guard<boost::recursive_mutex> lock(m_sn_mutex);
auto it = m_state.service_nodes_infos.find(pubkey);
if (it == m_state.service_nodes_infos.end()) {
LOG_PRINT_L2("No Service Node is known by this pubkey: " << pubkey);
return false;
} else {
proof_info &info = *it->second->proof;
if (info.storage_server_reachable != value)
{
info.storage_server_reachable = value;
LOG_PRINT_L2("Setting reachability status for node " << pubkey << " as: " << (value ? "true" : "false"));
}
info.storage_server_reachable_timestamp = time(nullptr);
return true;
}
}
static quorum_manager quorum_for_serialization_to_quorum_manager(service_node_list::quorum_for_serialization const &source)
{
quorum_manager result = {};
{
auto quorum = std::make_shared<testing_quorum>(source.quorums[static_cast<uint8_t>(quorum_type::obligations)]);
result.obligations = quorum;
}
// Don't load any checkpoints that shouldn't exist (see the comment in generate_quorums as to why the `+BUFFER` term is here).
if ((source.height + REORG_SAFETY_BUFFER_BLOCKS_POST_HF12) % CHECKPOINT_INTERVAL == 0)
{
auto quorum = std::make_shared<testing_quorum>(source.quorums[static_cast<uint8_t>(quorum_type::checkpointing)]);
result.checkpointing = quorum;
}
return result;
}
service_node_list::state_t::state_t(cryptonote::Blockchain const &blockchain, state_serialized &&state)
: height{state.height}
, key_image_blacklist{std::move(state.key_image_blacklist)}
, only_loaded_quorums{state.only_stored_quorums}
, block_hash{state.block_hash}
{
if (state.version == state_serialized::version_t::version_0)
block_hash = blockchain.get_block_id_by_height(height);
for (auto &pubkey_info : state.infos)
{
if (pubkey_info.info->version == service_node_info::version_0_checkpointing)
{
const_cast<service_node_info &>(*pubkey_info.info).version = service_node_info::version_1_add_registration_hf_version;
const_cast<service_node_info &>(*pubkey_info.info).registration_hf_version = blockchain.get_hard_fork_version(pubkey_info.info->registration_height);
}
service_nodes_infos.emplace(std::move(pubkey_info.pubkey), std::move(pubkey_info.info));
}
quorums = quorum_for_serialization_to_quorum_manager(state.quorums);
}
bool service_node_list::load(const uint64_t current_height)
{
LOG_PRINT_L1("service_node_list::load()");
reset(false);
if (!m_db)
{
return false;
}
// NOTE: Deserialize long term state history
uint64_t bytes_loaded = 0;
cryptonote::db_rtxn_guard txn_guard(m_db);
std::string blob;
if (m_db->get_service_node_data(blob, true /*long_term*/))
{
bytes_loaded += blob.size();
std::stringstream ss;
ss << blob;
blob.clear();
binary_archive<false> ba(ss);
data_for_serialization data_in = {};
if (::serialization::serialize(ba, data_in) && data_in.states.size())
{
// NOTE: Previously the quorum for the next state is derived from the
// state that's been updated from the next block. This is fixed in
// version_1.
// So, copy the quorum from (state.height-1) to (state.height), all
// states need to have their (height-1) which means we're missing the
// 10k-th interval and need to generate it based on the last state.
if (data_in.states[0].version == state_serialized::version_t::version_0)
{
size_t const last_index = data_in.states.size() - 1;
if ((data_in.states.back().height % STORE_LONG_TERM_STATE_INTERVAL) != 0)
{
LOG_PRINT_L0("Last serialised quorum height: " << data_in.states.back().height
<< " in archive is unexpectedly not a multiple of: "
<< STORE_LONG_TERM_STATE_INTERVAL << ", regenerating state");
return false;
}
for (size_t i = data_in.states.size() - 1; i >= 1; i--)
{
state_serialized &serialized_entry = data_in.states[i];
state_serialized &prev_serialized_entry = data_in.states[i - 1];
if ((prev_serialized_entry.height % STORE_LONG_TERM_STATE_INTERVAL) == 0)
{
// NOTE: drop this entry, we have insufficient data to derive
// sadly, do this as a one off and if we ever need this data we
// need to do a full rescan.
continue;
}
state_t entry(m_blockchain, std::move(serialized_entry));
entry.height--;
entry.quorums = quorum_for_serialization_to_quorum_manager(prev_serialized_entry.quorums);
if ((serialized_entry.height % STORE_LONG_TERM_STATE_INTERVAL) == 0)
{
state_t long_term_state = entry;
cryptonote::block const &block = m_db->get_block_from_height(long_term_state.height + 1);
std::vector<cryptonote::transaction> txs = m_db->get_tx_list(block.tx_hashes);
long_term_state.update_from_block(*m_db, m_blockchain.nettype(), {} /*state_history*/, {} /*alt_states*/, block, txs, nullptr /*my_pubkey*/);
entry.service_nodes_infos = {};
entry.key_image_blacklist = {};
entry.only_loaded_quorums = true;
m_state_archive.emplace_hint(m_state_archive.begin(), std::move(long_term_state));
}
m_state_archive.emplace_hint(m_state_archive.begin(), std::move(entry));
}
}
else
{
for (state_serialized &entry : data_in.states)
m_state_archive.emplace_hint(m_state_archive.end(), m_blockchain, std::move(entry));
}
}
}
// NOTE: Deserialize short term state history
if (!m_db->get_service_node_data(blob, false))
return false;
bytes_loaded += blob.size();
std::stringstream ss;
ss << blob;
binary_archive<false> ba(ss);
data_for_serialization data_in = {};
bool deserialized = ::serialization::serialize(ba, data_in);
CHECK_AND_ASSERT_MES(deserialized, false, "Failed to parse service node data from blob");
if (data_in.states.empty())
return false;
{
const uint64_t hist_state_from_height = current_height - m_store_quorum_history;
uint64_t last_loaded_height = 0;
for (auto &states : data_in.quorum_states)
{
if (states.height < hist_state_from_height)
continue;
quorums_by_height entry = {};
entry.height = states.height;
entry.quorums = quorum_for_serialization_to_quorum_manager(states);
if (states.height <= last_loaded_height)
{
LOG_PRINT_L0("Serialised quorums is not stored in ascending order by height in DB, failed to load from DB");
return false;
}
last_loaded_height = states.height;
m_old_quorum_states.push_back(entry);
}
}
{
assert(data_in.states.size() > 0);
size_t const last_index = data_in.states.size() - 1;
if (data_in.states[last_index].only_stored_quorums)
{
LOG_PRINT_L0("Unexpected last serialized state only has quorums loaded");
return false;
}
if (data_in.states[0].version == state_serialized::version_t::version_0)
{
for (size_t i = last_index; i >= 1; i--)
{
state_serialized &serialized_entry = data_in.states[i];
state_serialized &prev_serialized_entry = data_in.states[i - 1];
state_t entry(m_blockchain, std::move(serialized_entry));
entry.quorums = quorum_for_serialization_to_quorum_manager(prev_serialized_entry.quorums);
entry.height--;
if (i == last_index) m_state = std::move(entry);
else m_state_archive.emplace_hint(m_state_archive.end(), std::move(entry));
}
}
else
{
size_t const last_index = data_in.states.size() - 1;
for (size_t i = 0; i < last_index; i++)
{
state_serialized &entry = data_in.states[i];
if (entry.block_hash == crypto::null_hash) entry.block_hash = m_blockchain.get_block_id_by_height(entry.height);
m_state_history.emplace_hint(m_state_history.end(), m_blockchain, std::move(entry));
}
state_serialized &last_entry = data_in.states[last_index];
m_state = state_t(m_blockchain, std::move(last_entry));
}
}
MGINFO("Service node data loaded successfully, height: " << m_state.height);
MGINFO(m_state.service_nodes_infos.size()
<< " nodes and " << m_state_history.size() << " recent states loaded, " << m_state_archive.size()
<< " historical states loaded, (" << tools::get_human_readable_bytes(bytes_loaded) << ")");
LOG_PRINT_L1("service_node_list::load() returning success");
return true;
}
void service_node_list::reset(bool delete_db_entry)
{
m_state_history.clear();
m_old_quorum_states.clear();
m_state = {};
if (m_db && delete_db_entry)
{
cryptonote::db_wtxn_guard txn_guard(m_db);
m_db->clear_service_node_data();
}
uint64_t hardfork_9_from_height = 0;
{
uint32_t window, votes, threshold;
uint8_t voting;
m_blockchain.get_hard_fork_voting_info(9, window, votes, threshold, hardfork_9_from_height, voting);
}
m_state.height = hardfork_9_from_height - 1;
}
Infinite Staking Part 2 (#406) * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add command to print locked key images * Update ui to display lock stakes, query in print cmd blacklist * Modify print stakes to be less slow * Remove autostaking code * Refactor staking into sweep functions It appears staking was derived off stake_main written separately at implementation at the beginning. This merges them back into a common code path, after removing autostake there's only some minor differences. It also makes sure that any changes to sweeping upstream are going to be considered in the staking process which we want. * Display unlock height for stakes * Begin creating output blacklist * Make blacklist output a migration step * Implement get_output_blacklist for lmdb * In wallet output selection ignore blacklisted outputs * Apply blacklisted outputs to output selection * Fix broken tests, switch key image unlock * Fix broken unit_tests * Begin change to limit locked key images to 4 globally * Revamp prepare registration for new min contribution rules * Fix up old back case in prepare registration * Remove debug code * Cleanup debug code and some unecessary changes * Fix migration step on mainnet db * Fix blacklist outputs for pre-existing DB's * Remove irrelevant note * Tweak scanning addresses for locked stakes Since we only now allow contributions from the primary address we can skip checking all subaddress + lookahead to speed up wallet scanning * Define macro for SCNu64 for Mingw * Fix failure on empty DB * Add missing error msg, remove contributor from stake * Improve staking messages * Flush prompt to always display * Return the msg from stake failure and fix stake parsing error * Tweak fork rules for smaller bulletproofs * Tweak pooled nodes minimum amounts * Fix crash on exit, there's no need to store on destructor Since all information about service nodes is derived from the blockchain and we store state every time we receive a block, storing in the destructor is redundant as there is no new information to store. * Make prompt be consistent with CLI * Check max number of key images from per user to node * Implement error message on get_output_blacklist failure * Remove resolved TODO's/comments * Handle infinite staking in print_sn * Atoi->strtol, fix prepare_registration, virtual override, stale msgs
2019-02-14 02:12:57 +01:00
size_t service_node_info::total_num_locked_contributions() const
{
size_t result = 0;
for (service_node_info::contributor_t const &contributor : this->contributors)
result += contributor.locked_contributions.size();
return result;
}
converted_registration_args convert_registration_args(cryptonote::network_type nettype,
const std::vector<std::string>& args,
uint64_t staking_requirement,
uint8_t hf_version)
{
converted_registration_args result = {};
2018-08-16 07:14:28 +02:00
if (args.size() % 2 == 0 || args.size() < 3)
{
result.err_msg = tr("Usage: <operator cut> <address> <fraction> [<address> <fraction> [...]]]");
return result;
}
2018-08-16 07:14:28 +02:00
if ((args.size()-1)/ 2 > MAX_NUMBER_OF_CONTRIBUTORS)
{
result.err_msg = tr("Exceeds the maximum number of contributors, which is ") + std::to_string(MAX_NUMBER_OF_CONTRIBUTORS);
return result;
}
try
{
result.portions_for_operator = boost::lexical_cast<uint64_t>(args[0]);
if (result.portions_for_operator > STAKING_PORTIONS)
{
result.err_msg = tr("Invalid portion amount: ") + args[0] + tr(". Must be between 0 and ") + std::to_string(STAKING_PORTIONS);
return result;
}
}
catch (const std::exception &e)
{
result.err_msg = tr("Invalid portion amount: ") + args[0] + tr(". Must be between 0 and ") + std::to_string(STAKING_PORTIONS);
return result;
}
struct addr_to_portion_t
{
cryptonote::address_parse_info info;
uint64_t portions;
};
std::vector<addr_to_portion_t> addr_to_portions;
size_t const OPERATOR_ARG_INDEX = 1;
for (size_t i = OPERATOR_ARG_INDEX, num_contributions = 0;
i < args.size();
i += 2, ++num_contributions)
{
cryptonote::address_parse_info info;
if (!cryptonote::get_account_address_from_str(info, nettype, args[i]))
{
result.err_msg = tr("Failed to parse address: ") + args[i];
return result;
}
if (info.has_payment_id)
{
result.err_msg = tr("Can't use a payment id for staking tx");
return result;
}
if (info.is_subaddress)
{
result.err_msg = tr("Can't use a subaddress for staking tx");
return result;
}
try
{
uint64_t num_portions = boost::lexical_cast<uint64_t>(args[i+1]);
addr_to_portions.push_back({info, num_portions});
}
catch (const std::exception &e)
{
result.err_msg = tr("Invalid amount for contributor: ") + args[i] + tr(", with portion amount that could not be converted to a number: ") + args[i+1];
return result;
}
}
//
// FIXME(doyle): FIXME(loki) !!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!
// This is temporary code to redistribute the insufficient portion dust
// amounts between contributors. It should be removed in HF12.
//
std::array<uint64_t, MAX_NUMBER_OF_CONTRIBUTORS * service_nodes::MAX_KEY_IMAGES_PER_CONTRIBUTOR> excess_portions;
std::array<uint64_t, MAX_NUMBER_OF_CONTRIBUTORS * service_nodes::MAX_KEY_IMAGES_PER_CONTRIBUTOR> min_contributions;
{
// NOTE: Calculate excess portions from each contributor
uint64_t loki_reserved = 0;
for (size_t index = 0; index < addr_to_portions.size(); ++index)
{
addr_to_portion_t const &addr_to_portion = addr_to_portions[index];
uint64_t min_contribution_portions = service_nodes::get_min_node_contribution_in_portions(hf_version, staking_requirement, loki_reserved, index);
uint64_t loki_amount = service_nodes::portions_to_amount(staking_requirement, addr_to_portion.portions);
loki_reserved += loki_amount;
uint64_t excess = 0;
if (addr_to_portion.portions > min_contribution_portions)
excess = addr_to_portion.portions - min_contribution_portions;
min_contributions[index] = min_contribution_portions;
excess_portions[index] = excess;
}
}
uint64_t portions_left = STAKING_PORTIONS;
uint64_t total_reserved = 0;
for (size_t i = 0; i < addr_to_portions.size(); ++i)
{
addr_to_portion_t &addr_to_portion = addr_to_portions[i];
uint64_t min_portions = get_min_node_contribution_in_portions(hf_version, staking_requirement, total_reserved, i);
uint64_t portions_to_steal = 0;
if (addr_to_portion.portions < min_portions)
{
// NOTE: Steal dust portions from other contributor if we fall below
// the minimum by a dust amount.
uint64_t needed = min_portions - addr_to_portion.portions;
const uint64_t FUDGE_FACTOR = 10;
const uint64_t DUST_UNIT = (STAKING_PORTIONS / staking_requirement);
const uint64_t DUST = DUST_UNIT * FUDGE_FACTOR;
if (needed > DUST)
continue;
for (size_t sub_index = 0; sub_index < addr_to_portions.size(); sub_index++)
{
if (i == sub_index) continue;
uint64_t &contributor_excess = excess_portions[sub_index];
if (contributor_excess > 0)
{
portions_to_steal = std::min(needed, contributor_excess);
addr_to_portion.portions += portions_to_steal;
contributor_excess -= portions_to_steal;
needed -= portions_to_steal;
result.portions[sub_index] -= portions_to_steal;
if (needed == 0)
break;
}
}
// NOTE: Operator is sending in the minimum amount and it falls below
// the minimum by dust, just increase the portions so it passes
if (needed > 0 && addr_to_portions.size() < MAX_NUMBER_OF_CONTRIBUTORS * service_nodes::MAX_KEY_IMAGES_PER_CONTRIBUTOR)
addr_to_portion.portions += needed;
}
if (addr_to_portion.portions < min_portions || (addr_to_portion.portions - portions_to_steal) > portions_left)
{
result.err_msg = tr("Invalid amount for contributor: ") + args[i] + tr(", with portion amount: ") + args[i+1] + tr(". The contributors must each have at least 25%, except for the last contributor which may have the remaining amount");
return result;
}
if (min_portions == UINT64_MAX)
{
result.err_msg = tr("Too many contributors specified, you can only split a node with up to: ") + std::to_string(MAX_NUMBER_OF_CONTRIBUTORS) + tr(" people.");
return result;
}
portions_left -= addr_to_portion.portions;
portions_left += portions_to_steal;
result.addresses.push_back(addr_to_portion.info.address);
result.portions.push_back(addr_to_portion.portions);
uint64_t loki_amount = service_nodes::portions_to_amount(addr_to_portion.portions, staking_requirement);
total_reserved += loki_amount;
}
result.success = true;
return result;
}
bool make_registration_cmd(cryptonote::network_type nettype,
uint8_t hf_version,
uint64_t staking_requirement,
const std::vector<std::string>& args,
const crypto::public_key& service_node_pubkey,
const crypto::secret_key &service_node_key,
std::string &cmd,
bool make_friendly,
boost::optional<std::string&> err_msg)
{
converted_registration_args converted_args = convert_registration_args(nettype, args, staking_requirement, hf_version);
if (!converted_args.success)
{
MERROR(tr("Could not convert registration args, reason: ") << converted_args.err_msg);
return false;
}
Infinite Staking Part 2 (#406) * Cleanup and undoing some protocol breakages * Simplify expiration of nodes * Request unlock schedules entire node for expiration * Fix off by one in expiring nodes * Undo expiring code for pre v10 nodes * Fix RPC returning register as unlock height and not checking 0 * Rename key image unlock height const * Undo testnet hardfork debug changes * Remove is_type for get_type, fix missing var rename * Move serialisable data into public namespace * Serialise tx types properly * Fix typo in no service node known msg * Code review * Fix == to >= on serialising tx type * Code review 2 * Fix tests and key image unlock * Add command to print locked key images * Update ui to display lock stakes, query in print cmd blacklist * Modify print stakes to be less slow * Remove autostaking code * Refactor staking into sweep functions It appears staking was derived off stake_main written separately at implementation at the beginning. This merges them back into a common code path, after removing autostake there's only some minor differences. It also makes sure that any changes to sweeping upstream are going to be considered in the staking process which we want. * Display unlock height for stakes * Begin creating output blacklist * Make blacklist output a migration step * Implement get_output_blacklist for lmdb * In wallet output selection ignore blacklisted outputs * Apply blacklisted outputs to output selection * Fix broken tests, switch key image unlock * Fix broken unit_tests * Begin change to limit locked key images to 4 globally * Revamp prepare registration for new min contribution rules * Fix up old back case in prepare registration * Remove debug code * Cleanup debug code and some unecessary changes * Fix migration step on mainnet db * Fix blacklist outputs for pre-existing DB's * Remove irrelevant note * Tweak scanning addresses for locked stakes Since we only now allow contributions from the primary address we can skip checking all subaddress + lookahead to speed up wallet scanning * Define macro for SCNu64 for Mingw * Fix failure on empty DB * Add missing error msg, remove contributor from stake * Improve staking messages * Flush prompt to always display * Return the msg from stake failure and fix stake parsing error * Tweak fork rules for smaller bulletproofs * Tweak pooled nodes minimum amounts * Fix crash on exit, there's no need to store on destructor Since all information about service nodes is derived from the blockchain and we store state every time we receive a block, storing in the destructor is redundant as there is no new information to store. * Make prompt be consistent with CLI * Check max number of key images from per user to node * Implement error message on get_output_blacklist failure * Remove resolved TODO's/comments * Handle infinite staking in print_sn * Atoi->strtol, fix prepare_registration, virtual override, stale msgs
2019-02-14 02:12:57 +01:00
uint64_t exp_timestamp = time(nullptr) + STAKING_AUTHORIZATION_EXPIRATION_WINDOW;
crypto::hash hash;
bool hashed = cryptonote::get_registration_hash(converted_args.addresses, converted_args.portions_for_operator, converted_args.portions, exp_timestamp, hash);
if (!hashed)
{
MERROR(tr("Could not make registration hash from addresses and portions"));
return false;
}
crypto::signature signature;
crypto::generate_signature(hash, service_node_pubkey, service_node_key, signature);
std::stringstream stream;
if (make_friendly)
{
stream << tr("Run this command in the wallet that will fund this registration:\n\n");
}
stream << "register_service_node";
for (size_t i = 0; i < args.size(); ++i)
{
stream << " " << args[i];
}
stream << " " << exp_timestamp << " ";
stream << epee::string_tools::pod_to_hex(service_node_pubkey) << " ";
stream << epee::string_tools::pod_to_hex(signature);
if (make_friendly)
{
stream << "\n\n";
time_t tt = exp_timestamp;
struct tm tm;
epee::misc_utils::get_gmt_time(tt, tm);
char buffer[128];
strftime(buffer, sizeof(buffer), "%Y-%m-%d %I:%M:%S %p", &tm);
2018-08-16 07:14:28 +02:00
stream << tr("This registration expires at ") << buffer << tr(".\n");
stream << tr("This should be in about 2 weeks, if it isn't, check this computer's clock.\n");
stream << tr("Please submit your registration into the blockchain before this time or it will be invalid.");
}
cmd = stream.str();
return true;
}
bool service_node_info::can_be_voted_on(uint64_t height) const
{
// If the SN expired and was reregistered since the height we'll be voting on it prematurely
if (!this->is_fully_funded() || this->registration_height >= height) return false;
if (this->is_decommissioned() && this->last_decommission_height >= height) return false;
if (this->is_active())
{
// NOTE: This cast is safe. The definition of is_active() is that active_since_height >= 0
assert(this->active_since_height >= 0);
if (static_cast<uint64_t>(this->active_since_height) >= height) return false;
}
return true;
}
bool service_node_info::can_transition_to_state(uint8_t hf_version, uint64_t height, new_state proposed_state) const
{
if (hf_version >= cryptonote::network_version_13_enforce_checkpoints)
{
if (!can_be_voted_on(height))
return false;
if (proposed_state == new_state::deregister)
{
if (height <= this->registration_height)
return false;
}
else if (proposed_state == new_state::ip_change_penalty)
{
if (height <= this->last_ip_change_height)
return false;
}
if (this->is_decommissioned())
{
return proposed_state != new_state::decommission && proposed_state != new_state::ip_change_penalty;
}
return (proposed_state != new_state::recommission);
}
else
{
if (proposed_state == new_state::deregister)
{
if (height < this->registration_height) return false;
}
if (this->is_decommissioned())
{
return proposed_state != new_state::decommission && proposed_state != new_state::ip_change_penalty;
}
else
{
return (proposed_state != new_state::recommission);
}
}
}
2018-06-29 06:47:00 +02:00
}